C24H29F6NOSi — CID 159582739
[bis[3-methyl-5-(trifluoromethyl)phenyl]-pyrrolidin-2-ylmethoxy]-trimethylsilane (PubChem CID 159582739) has the molecular formula C24H29F6NOSi and a molecular weight of 489.58 g/mol. Its IUPAC name is [bis[3-methyl-5-(trifluoromethyl)phenyl]-pyrrolidin-2-ylmethoxy]-trimethylsilane.
| Compound Name | [bis[3-methyl-5-(trifluoromethyl)phenyl]-pyrrolidin-2-ylmethoxy]-trimethylsilane |
|---|---|
| PubChem CID | 159582739 |
| Molecular Formula | C24H29F6NOSi |
| Molecular Weight | 489.58 g/mol |
| Exact Mass | 489.19 |
| IUPAC Name | [bis[3-methyl-5-(trifluoromethyl)phenyl]-pyrrolidin-2-ylmethoxy]-trimethylsilane |
| SMILES | Cc1cc(C(F)(F)F)cc(C(O[Si](C)(C)C)(c2cc(C)cc(C(F)(F)F)c2)C2CCCN2)c1 |
| InChI | InChI=1S/C24H29F6NOSi/c1-15-9-17(13-19(11-15)23(25,26)27)22(32-33(3,4)5,21-7-6-8-31-21)18-10-16(2)12-20(14-18)24(28,29)30/h9-14,21,31H,6-8H2,1-5H3 |
| InChIKey | MJFMILDRNJYGSG-UHFFFAOYSA-N |
| XLogP | 7.19 |
| TPSA | 21.26 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 33 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 489.58 |
| LogP ≤ 5 | 7.19 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|