About acetylene;2-(1-hydroxyethyl)oxan-3-ol;methane
acetylene;2-(1-hydroxyethyl)oxan-3-ol;methane (PubChem CID 159584740) has the molecular formula C12H28O3
and a molecular weight of 220.35 g/mol. Its IUPAC name is acetylene;2-(1-hydroxyethyl)oxan-3-ol;methane.
Molecular Properties
| Compound Name | acetylene;2-(1-hydroxyethyl)oxan-3-ol;methane |
| PubChem CID | 159584740 |
| Molecular Formula | C12H28O3 |
| Molecular Weight | 220.35 g/mol |
| Exact Mass | 220.20 |
| IUPAC Name | acetylene;2-(1-hydroxyethyl)oxan-3-ol;methane |
| SMILES | C.C.C.C#C.CC(O)C1OCCCC1O |
| InChI | InChI=1S/C7H14O3.C2H2.3CH4/c1-5(8)7-6(9)3-2-4-10-7;1-2;;;/h5-9H,2-4H2,1H3;1-2H;3*1H4 |
| InChIKey | MJLWEIPSNMLOTN-UHFFFAOYSA-N |
| XLogP | 2.06 |
| TPSA | 49.69 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 15 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 220.35 |
| LogP ≤ 5 | 2.06 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|
Analyze acetylene;2-(1-hydroxyethyl)oxan-3-ol;methane with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of acetylene;2-(1-hydroxyethyl)oxan-3-ol;methane?
The IUPAC name of acetylene;2-(1-hydroxyethyl)oxan-3-ol;methane (CID 159584740) is acetylene;2-(1-hydroxyethyl)oxan-3-ol;methane.
What is the SMILES notation for acetylene;2-(1-hydroxyethyl)oxan-3-ol;methane?
The canonical SMILES for acetylene;2-(1-hydroxyethyl)oxan-3-ol;methane is C.C.C.C#C.CC(O)C1OCCCC1O.
What is the InChIKey of acetylene;2-(1-hydroxyethyl)oxan-3-ol;methane?
The InChIKey is MJLWEIPSNMLOTN-UHFFFAOYSA-N. The full InChI is InChI=1S/C7H14O3.C2H2.3CH4/c1-5(8)7-6(9)3-2-4-10-7;1-2;;;/h5-9H,2-4H2,1H3;1-2H;3*1H4.
What are the key properties of acetylene;2-(1-hydroxyethyl)oxan-3-ol;methane?
acetylene;2-(1-hydroxyethyl)oxan-3-ol;methane has a molecular weight of 220.35 g/mol, XLogP of 2.06, 1 rotatable bonds, 2 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for acetylene;2-(1-hydroxyethyl)oxan-3-ol;methane is sourced from PubChem (CID 159584740), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).