5-(1-benzylindol-3-yl)-1,2-oxazole-3-carboxylic acid

C19H14N2O3 — CID 15958516

IUPAC5-(1-benzylindol-3-yl)-1,2-oxazole-3-carboxylic acid
SMILESO=C(O)c1cc(-c2cn(Cc3ccccc3)c3ccccc23)on1
InChIInChI=1S/C19H14N2O3/c22-19(23)16-10-18(24-20-16)15-12-21(11-13-6-2-1-3-7-13)17-9-5-4-8-14(15)17/h1-10,12H,11H2,(H,22,23)
InChIKeyHDCGBDTUCWMBBX-UHFFFAOYSA-N
MW318.33 g/mol
LogP4.04
Rot. Bonds4

About 5-(1-benzylindol-3-yl)-1,2-oxazole-3-carboxylic acid

5-(1-benzylindol-3-yl)-1,2-oxazole-3-carboxylic acid (PubChem CID 15958516) has the molecular formula C19H14N2O3 and a molecular weight of 318.33 g/mol. Its IUPAC name is 5-(1-benzylindol-3-yl)-1,2-oxazole-3-carboxylic acid.

Molecular Properties

Compound Name5-(1-benzylindol-3-yl)-1,2-oxazole-3-carboxylic acid
PubChem CID15958516
Molecular FormulaC19H14N2O3
Molecular Weight318.33 g/mol
Exact Mass318.10
IUPAC Name5-(1-benzylindol-3-yl)-1,2-oxazole-3-carboxylic acid
SMILESO=C(O)c1cc(-c2cn(Cc3ccccc3)c3ccccc23)on1
InChIInChI=1S/C19H14N2O3/c22-19(23)16-10-18(24-20-16)15-12-21(11-13-6-2-1-3-7-13)17-9-5-4-8-14(15)17/h1-10,12H,11H2,(H,22,23)
InChIKeyHDCGBDTUCWMBBX-UHFFFAOYSA-N
XLogP4.04
TPSA68.26 Ų
H-Bond Donors1
H-Bond Acceptors4
Rotatable Bonds4
Heavy Atoms24
Complexity

Lipinski Rule of Five

Passes Rule of Five

RuleValue
MW ≤ 500318.33
LogP ≤ 54.04
H-Bond Donors ≤ 51
H-Bond Acceptors ≤ 104

Analyze 5-(1-benzylindol-3-yl)-1,2-oxazole-3-carboxylic acid with MolForge

Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.

Launch Full Analysis

Frequently Asked Questions

What is the IUPAC name of 5-(1-benzylindol-3-yl)-1,2-oxazole-3-carboxylic acid?
The IUPAC name of 5-(1-benzylindol-3-yl)-1,2-oxazole-3-carboxylic acid (CID 15958516) is 5-(1-benzylindol-3-yl)-1,2-oxazole-3-carboxylic acid.
What is the SMILES notation for 5-(1-benzylindol-3-yl)-1,2-oxazole-3-carboxylic acid?
The canonical SMILES for 5-(1-benzylindol-3-yl)-1,2-oxazole-3-carboxylic acid is O=C(O)c1cc(-c2cn(Cc3ccccc3)c3ccccc23)on1.
What is the InChIKey of 5-(1-benzylindol-3-yl)-1,2-oxazole-3-carboxylic acid?
The InChIKey is HDCGBDTUCWMBBX-UHFFFAOYSA-N. The full InChI is InChI=1S/C19H14N2O3/c22-19(23)16-10-18(24-20-16)15-12-21(11-13-6-2-1-3-7-13)17-9-5-4-8-14(15)17/h1-10,12H,11H2,(H,22,23).
What are the key properties of 5-(1-benzylindol-3-yl)-1,2-oxazole-3-carboxylic acid?
5-(1-benzylindol-3-yl)-1,2-oxazole-3-carboxylic acid has a molecular weight of 318.33 g/mol, XLogP of 4.04, 4 rotatable bonds, 1 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 5-(1-benzylindol-3-yl)-1,2-oxazole-3-carboxylic acid is sourced from PubChem (CID 15958516), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).