About nickel(2+);oxalic acid;sulfate
nickel(2+);oxalic acid;sulfate (PubChem CID 159586152) has the molecular formula C2H2NiO8S
and a molecular weight of 244.79 g/mol. Its IUPAC name is nickel(2+);oxalic acid;sulfate.
Molecular Properties
| Compound Name | nickel(2+);oxalic acid;sulfate |
| PubChem CID | 159586152 |
| Molecular Formula | C2H2NiO8S |
| Molecular Weight | 244.79 g/mol |
| Exact Mass | 243.88 |
| IUPAC Name | nickel(2+);oxalic acid;sulfate |
| SMILES | O=C(O)C(=O)O.O=S(=O)([O-])[O-].[Ni+2] |
| InChI | InChI=1S/C2H2O4.Ni.H2O4S/c3-1(4)2(5)6;;1-5(2,3)4/h(H,3,4)(H,5,6);;(H2,1,2,3,4)/q;+2;/p-2 |
| InChIKey | MJQILBLOQQGPCG-UHFFFAOYSA-L |
| XLogP | -2.18 |
| TPSA | 154.86 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | |
| Heavy Atoms | 12 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 244.79 |
| LogP ≤ 5 | -2.18 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'diketo_group', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'}, {'alert_name': 'sulphate', 'substructure': 'N/A'} |
|---|
Analyze nickel(2+);oxalic acid;sulfate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of nickel(2+);oxalic acid;sulfate?
The IUPAC name of nickel(2+);oxalic acid;sulfate (CID 159586152) is nickel(2+);oxalic acid;sulfate.
What is the SMILES notation for nickel(2+);oxalic acid;sulfate?
The canonical SMILES for nickel(2+);oxalic acid;sulfate is O=C(O)C(=O)O.O=S(=O)([O-])[O-].[Ni+2].
What is the InChIKey of nickel(2+);oxalic acid;sulfate?
The InChIKey is MJQILBLOQQGPCG-UHFFFAOYSA-L. The full InChI is InChI=1S/C2H2O4.Ni.H2O4S/c3-1(4)2(5)6;;1-5(2,3)4/h(H,3,4)(H,5,6);;(H2,1,2,3,4)/q;+2;/p-2.
What are the key properties of nickel(2+);oxalic acid;sulfate?
nickel(2+);oxalic acid;sulfate has a molecular weight of 244.79 g/mol, XLogP of -2.18, 0 rotatable bonds, 2 hydrogen bond donors, and 6 hydrogen bond acceptors.
Where does this data come from?
All data for nickel(2+);oxalic acid;sulfate is sourced from PubChem (CID 159586152), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).