C14H16F3NO4S — CID 159590266
carbon dioxide;1-(3-ethylsulfanyl-2-pyridinyl)-3-hydroxy-3-(trifluoromethyl)pentan-1-one (PubChem CID 159590266) has the molecular formula C14H16F3NO4S and a molecular weight of 351.35 g/mol. Its IUPAC name is carbon dioxide;1-(3-ethylsulfanyl-2-pyridinyl)-3-hydroxy-3-(trifluoromethyl)pentan-1-one.
| Compound Name | carbon dioxide;1-(3-ethylsulfanyl-2-pyridinyl)-3-hydroxy-3-(trifluoromethyl)pentan-1-one |
|---|---|
| PubChem CID | 159590266 |
| Molecular Formula | C14H16F3NO4S |
| Molecular Weight | 351.35 g/mol |
| Exact Mass | 351.08 |
| IUPAC Name | carbon dioxide;1-(3-ethylsulfanyl-2-pyridinyl)-3-hydroxy-3-(trifluoromethyl)pentan-1-one |
| SMILES | CCSc1cccnc1C(=O)CC(O)(CC)C(F)(F)F.O=C=O |
| InChI | InChI=1S/C13H16F3NO2S.CO2/c1-3-12(19,13(14,15)16)8-9(18)11-10(20-4-2)6-5-7-17-11;2-1-3/h5-7,19H,3-4,8H2,1-2H3; |
| InChIKey | MKDKKZNBNXCNJA-UHFFFAOYSA-N |
| XLogP | 2.89 |
| TPSA | 84.33 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 351.35 |
| LogP ≤ 5 | 2.89 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |