C44H40N2O9 — CID 159592981
2-(2,4-dioxocyclohexyl)-4-phenoxyisoindole-1,3-dione;methane;2-(4-methylidene-2-oxocyclohexyl)-4-(2-phenylethoxy)isoindole-1,3-dione (PubChem CID 159592981) has the molecular formula C44H40N2O9 and a molecular weight of 740.81 g/mol. Its IUPAC name is 2-(2,4-dioxocyclohexyl)-4-phenoxyisoindole-1,3-dione;methane;2-(4-methylidene-2-oxocyclohexyl)-4-(2-phenylethoxy)isoindole-1,3-dione.
| Compound Name | 2-(2,4-dioxocyclohexyl)-4-phenoxyisoindole-1,3-dione;methane;2-(4-methylidene-2-oxocyclohexyl)-4-(2-phenylethoxy)isoindole-1,3-dione |
|---|---|
| PubChem CID | 159592981 |
| Molecular Formula | C44H40N2O9 |
| Molecular Weight | 740.81 g/mol |
| Exact Mass | 740.27 |
| IUPAC Name | 2-(2,4-dioxocyclohexyl)-4-phenoxyisoindole-1,3-dione;methane;2-(4-methylidene-2-oxocyclohexyl)-4-(2-phenylethoxy)isoindole-1,3-dione |
| SMILES | C.C=C1CCC(N2C(=O)c3cccc(OCCc4ccccc4)c3C2=O)C(=O)C1.O=C1CCC(N2C(=O)c3cccc(Oc4ccccc4)c3C2=O)C(=O)C1 |
| InChI | InChI=1S/C23H21NO4.C20H15NO5.CH4/c1-15-10-11-18(19(25)14-15)24-22(26)17-8-5-9-20(21(17)23(24)27)28-13-12-16-6-3-2-4-7-16;22-12-9-10-15(16(23)11-12)21-19(24)14-7-4-8-17(18(14)20(21)25)26-13-5-2-1-3-6-13;/h2-9,18H,1,10-14H2;1-8,15H,9-11H2;1H4 |
| InChIKey | MKLYCYXFFBEXHV-UHFFFAOYSA-N |
| XLogP | 6.98 |
| TPSA | 144.43 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 55 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 740.81 |
| LogP ≤ 5 | 6.98 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|