About bis(2-methylpent-1-en-3-one);pyridine
bis(2-methylpent-1-en-3-one);pyridine (PubChem CID 159594079) has the molecular formula C17H25NO2
and a molecular weight of 275.39 g/mol. Its IUPAC name is bis(2-methylpent-1-en-3-one);pyridine.
Molecular Properties
| Compound Name | bis(2-methylpent-1-en-3-one);pyridine |
| PubChem CID | 159594079 |
| Molecular Formula | C17H25NO2 |
| Molecular Weight | 275.39 g/mol |
| Exact Mass | 275.19 |
| IUPAC Name | bis(2-methylpent-1-en-3-one);pyridine |
| SMILES | C=C(C)C(=O)CC.C=C(C)C(=O)CC.c1ccncc1 |
| InChI | InChI=1S/2C6H10O.C5H5N/c2*1-4-6(7)5(2)3;1-2-4-6-5-3-1/h2*2,4H2,1,3H3;1-5H |
| InChIKey | MKPMRPNNFWBKQC-UHFFFAOYSA-N |
| XLogP | 4.16 |
| TPSA | 47.03 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 20 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 275.39 |
| LogP ≤ 5 | 4.16 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|
Analyze bis(2-methylpent-1-en-3-one);pyridine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of bis(2-methylpent-1-en-3-one);pyridine?
The IUPAC name of bis(2-methylpent-1-en-3-one);pyridine (CID 159594079) is bis(2-methylpent-1-en-3-one);pyridine.
What is the SMILES notation for bis(2-methylpent-1-en-3-one);pyridine?
The canonical SMILES for bis(2-methylpent-1-en-3-one);pyridine is C=C(C)C(=O)CC.C=C(C)C(=O)CC.c1ccncc1.
What is the InChIKey of bis(2-methylpent-1-en-3-one);pyridine?
The InChIKey is MKPMRPNNFWBKQC-UHFFFAOYSA-N. The full InChI is InChI=1S/2C6H10O.C5H5N/c2*1-4-6(7)5(2)3;1-2-4-6-5-3-1/h2*2,4H2,1,3H3;1-5H.
What are the key properties of bis(2-methylpent-1-en-3-one);pyridine?
bis(2-methylpent-1-en-3-one);pyridine has a molecular weight of 275.39 g/mol, XLogP of 4.16, 4 rotatable bonds, 0 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for bis(2-methylpent-1-en-3-one);pyridine is sourced from PubChem (CID 159594079), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).