C30H34FN4O3+ — CID 159596216
N-[8-[(6-fluoronaphthalen-2-yl)methyl]-8-azabicyclo[3.2.1]octan-3-yl]-1-hydroxy-3-(piperidine-1-carbonyl)pyridin-1-ium-4-carboxamide (PubChem CID 159596216) has the molecular formula C30H34FN4O3+ and a molecular weight of 517.63 g/mol. Its IUPAC name is N-[8-[(6-fluoronaphthalen-2-yl)methyl]-8-azabicyclo[3.2.1]octan-3-yl]-1-hydroxy-3-(piperidine-1-carbonyl)pyridin-1-ium-4-carboxamide.
| Compound Name | N-[8-[(6-fluoronaphthalen-2-yl)methyl]-8-azabicyclo[3.2.1]octan-3-yl]-1-hydroxy-3-(piperidine-1-carbonyl)pyridin-1-ium-4-carboxamide |
|---|---|
| PubChem CID | 159596216 |
| Molecular Formula | C30H34FN4O3+ |
| Molecular Weight | 517.63 g/mol |
| Exact Mass | 517.26 |
| IUPAC Name | N-[8-[(6-fluoronaphthalen-2-yl)methyl]-8-azabicyclo[3.2.1]octan-3-yl]-1-hydroxy-3-(piperidine-1-carbonyl)pyridin-1-ium-4-carboxamide |
| SMILES | O=C(NC1CC2CCC(C1)N2Cc1ccc2cc(F)ccc2c1)c1cc[n+](O)cc1C(=O)N1CCCCC1 |
| InChI | InChI=1S/C30H33FN4O3/c31-23-7-6-21-14-20(4-5-22(21)15-23)18-35-25-8-9-26(35)17-24(16-25)32-29(36)27-10-13-34(38)19-28(27)30(37)33-11-2-1-3-12-33/h4-7,10,13-15,19,24-26H,1-3,8-9,11-12,16-18H2,(H-,32,36,38)/p+1 |
| InChIKey | MYNQBINZALTBFJ-UHFFFAOYSA-O |
| XLogP | 4.06 |
| TPSA | 76.76 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 38 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 517.63 |
| LogP ≤ 5 | 4.06 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'N-hydroxyl_pyridine', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|