C40H32BBrN6O2 — CID 159597816
5-bromo-6-phenylpyrazin-2-amine;naphthalen-2-ylboronic acid;5-naphthalen-2-yl-6-phenylpyrazin-2-amine (PubChem CID 159597816) has the molecular formula C40H32BBrN6O2 and a molecular weight of 719.45 g/mol. Its IUPAC name is 5-bromo-6-phenylpyrazin-2-amine;naphthalen-2-ylboronic acid;5-naphthalen-2-yl-6-phenylpyrazin-2-amine.
| Compound Name | 5-bromo-6-phenylpyrazin-2-amine;naphthalen-2-ylboronic acid;5-naphthalen-2-yl-6-phenylpyrazin-2-amine |
|---|---|
| PubChem CID | 159597816 |
| Molecular Formula | C40H32BBrN6O2 |
| Molecular Weight | 719.45 g/mol |
| Exact Mass | 718.19 |
| IUPAC Name | 5-bromo-6-phenylpyrazin-2-amine;naphthalen-2-ylboronic acid;5-naphthalen-2-yl-6-phenylpyrazin-2-amine |
| SMILES | Nc1cnc(-c2ccc3ccccc3c2)c(-c2ccccc2)n1.Nc1cnc(Br)c(-c2ccccc2)n1.OB(O)c1ccc2ccccc2c1 |
| InChI | InChI=1S/C20H15N3.C10H9BO2.C10H8BrN3/c21-18-13-22-19(20(23-18)15-7-2-1-3-8-15)17-11-10-14-6-4-5-9-16(14)12-17;12-11(13)10-6-5-8-3-1-2-4-9(8)7-10;11-10-9(14-8(12)6-13-10)7-4-2-1-3-5-7/h1-13H,(H2,21,23);1-7,12-13H;1-6H,(H2,12,14) |
| InChIKey | MLBSDHJKBIOMPV-UHFFFAOYSA-N |
| XLogP | 7.55 |
| TPSA | 144.06 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 50 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 719.45 |
| LogP ≤ 5 | 7.55 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|