C12H20ClN3O — CID 159598247
[2-(1-methylpiperidin-4-yl)oxy-4-pyridinyl]methanamine;hydrochloride (PubChem CID 159598247) has the molecular formula C12H20ClN3O and a molecular weight of 257.76 g/mol. Its IUPAC name is [2-(1-methylpiperidin-4-yl)oxy-4-pyridinyl]methanamine;hydrochloride.
| Compound Name | [2-(1-methylpiperidin-4-yl)oxy-4-pyridinyl]methanamine;hydrochloride |
|---|---|
| PubChem CID | 159598247 |
| Molecular Formula | C12H20ClN3O |
| Molecular Weight | 257.76 g/mol |
| Exact Mass | 257.13 |
| IUPAC Name | [2-(1-methylpiperidin-4-yl)oxy-4-pyridinyl]methanamine;hydrochloride |
| SMILES | CN1CCC(Oc2cc(CN)ccn2)CC1.Cl |
| InChI | InChI=1S/C12H19N3O.ClH/c1-15-6-3-11(4-7-15)16-12-8-10(9-13)2-5-14-12;/h2,5,8,11H,3-4,6-7,9,13H2,1H3;1H |
| InChIKey | MLCYRQSWJHXSNW-UHFFFAOYSA-N |
| XLogP | 1.44 |
| TPSA | 51.38 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 257.76 |
| LogP ≤ 5 | 1.44 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |