C16H27N3O — CID 163390474
(2-ethoxy-4-pyridinyl)methanamine;3-methyl-3-azabicyclo[3.2.1]octane (PubChem CID 163390474) has the molecular formula C16H27N3O and a molecular weight of 277.41 g/mol. Its IUPAC name is (2-ethoxy-4-pyridinyl)methanamine;3-methyl-3-azabicyclo[3.2.1]octane.
| Compound Name | (2-ethoxy-4-pyridinyl)methanamine;3-methyl-3-azabicyclo[3.2.1]octane |
|---|---|
| PubChem CID | 163390474 |
| Molecular Formula | C16H27N3O |
| Molecular Weight | 277.41 g/mol |
| Exact Mass | 277.22 |
| IUPAC Name | (2-ethoxy-4-pyridinyl)methanamine;3-methyl-3-azabicyclo[3.2.1]octane |
| SMILES | CCOc1cc(CN)ccn1.CN1CC2CCC(C2)C1 |
| InChI | InChI=1S/C8H12N2O.C8H15N/c1-2-11-8-5-7(6-9)3-4-10-8;1-9-5-7-2-3-8(4-7)6-9/h3-5H,2,6,9H2,1H3;7-8H,2-6H2,1H3 |
| InChIKey | NJBAVGYLTFENKP-UHFFFAOYSA-N |
| XLogP | 2.29 |
| TPSA | 51.38 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 277.41 |
| LogP ≤ 5 | 2.29 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |