About thiophene-2-carbonitrile;1-thiophen-2-ylcyclopropan-1-amine
thiophene-2-carbonitrile;1-thiophen-2-ylcyclopropan-1-amine (PubChem CID 159599390) has the molecular formula C12H12N2S2
and a molecular weight of 248.38 g/mol. Its IUPAC name is thiophene-2-carbonitrile;1-thiophen-2-ylcyclopropan-1-amine.
Molecular Properties
| Compound Name | thiophene-2-carbonitrile;1-thiophen-2-ylcyclopropan-1-amine |
| PubChem CID | 159599390 |
| Molecular Formula | C12H12N2S2 |
| Molecular Weight | 248.38 g/mol |
| Exact Mass | 248.04 |
| IUPAC Name | thiophene-2-carbonitrile;1-thiophen-2-ylcyclopropan-1-amine |
| SMILES | N#Cc1cccs1.NC1(c2cccs2)CC1 |
| InChI | InChI=1S/C7H9NS.C5H3NS/c8-7(3-4-7)6-2-1-5-9-6;6-4-5-2-1-3-7-5/h1-2,5H,3-4,8H2;1-3H |
| InChIKey | MLGTXXCWCJLMMQ-UHFFFAOYSA-N |
| XLogP | 3.32 |
| TPSA | 49.81 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 16 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 248.38 |
| LogP ≤ 5 | 3.32 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze thiophene-2-carbonitrile;1-thiophen-2-ylcyclopropan-1-amine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of thiophene-2-carbonitrile;1-thiophen-2-ylcyclopropan-1-amine?
The IUPAC name of thiophene-2-carbonitrile;1-thiophen-2-ylcyclopropan-1-amine (CID 159599390) is thiophene-2-carbonitrile;1-thiophen-2-ylcyclopropan-1-amine.
What is the SMILES notation for thiophene-2-carbonitrile;1-thiophen-2-ylcyclopropan-1-amine?
The canonical SMILES for thiophene-2-carbonitrile;1-thiophen-2-ylcyclopropan-1-amine is N#Cc1cccs1.NC1(c2cccs2)CC1.
What is the InChIKey of thiophene-2-carbonitrile;1-thiophen-2-ylcyclopropan-1-amine?
The InChIKey is MLGTXXCWCJLMMQ-UHFFFAOYSA-N. The full InChI is InChI=1S/C7H9NS.C5H3NS/c8-7(3-4-7)6-2-1-5-9-6;6-4-5-2-1-3-7-5/h1-2,5H,3-4,8H2;1-3H.
What are the key properties of thiophene-2-carbonitrile;1-thiophen-2-ylcyclopropan-1-amine?
thiophene-2-carbonitrile;1-thiophen-2-ylcyclopropan-1-amine has a molecular weight of 248.38 g/mol, XLogP of 3.32, 1 rotatable bonds, 1 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for thiophene-2-carbonitrile;1-thiophen-2-ylcyclopropan-1-amine is sourced from PubChem (CID 159599390), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).