About N'-hydroxythiophene-2-carboximidamide;thiophene-2-carbonitrile
N'-hydroxythiophene-2-carboximidamide;thiophene-2-carbonitrile (PubChem CID 172953513) has the molecular formula C10H9N3OS2
and a molecular weight of 251.34 g/mol. Its IUPAC name is N'-hydroxythiophene-2-carboximidamide;thiophene-2-carbonitrile.
Molecular Properties
| Compound Name | N'-hydroxythiophene-2-carboximidamide;thiophene-2-carbonitrile |
| PubChem CID | 172953513 |
| Molecular Formula | C10H9N3OS2 |
| Molecular Weight | 251.34 g/mol |
| Exact Mass | 251.02 |
| IUPAC Name | N'-hydroxythiophene-2-carboximidamide;thiophene-2-carbonitrile |
| SMILES | N#Cc1cccs1.N/C(=N\O)c1cccs1 |
| InChI | InChI=1S/C5H6N2OS.C5H3NS/c6-5(7-8)4-2-1-3-9-4;6-4-5-2-1-3-7-5/h1-3,8H,(H2,6,7);1-3H |
| InChIKey | MZXMYIMLWZXZDU-UHFFFAOYSA-N |
| XLogP | 2.46 |
| TPSA | 82.40 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 16 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 251.34 |
| LogP ≤ 5 | 2.46 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'oxime_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|
Analyze N'-hydroxythiophene-2-carboximidamide;thiophene-2-carbonitrile with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of N'-hydroxythiophene-2-carboximidamide;thiophene-2-carbonitrile?
The IUPAC name of N'-hydroxythiophene-2-carboximidamide;thiophene-2-carbonitrile (CID 172953513) is N'-hydroxythiophene-2-carboximidamide;thiophene-2-carbonitrile.
What is the SMILES notation for N'-hydroxythiophene-2-carboximidamide;thiophene-2-carbonitrile?
The canonical SMILES for N'-hydroxythiophene-2-carboximidamide;thiophene-2-carbonitrile is N#Cc1cccs1.N/C(=N\O)c1cccs1.
What is the InChIKey of N'-hydroxythiophene-2-carboximidamide;thiophene-2-carbonitrile?
The InChIKey is MZXMYIMLWZXZDU-UHFFFAOYSA-N. The full InChI is InChI=1S/C5H6N2OS.C5H3NS/c6-5(7-8)4-2-1-3-9-4;6-4-5-2-1-3-7-5/h1-3,8H,(H2,6,7);1-3H.
What are the key properties of N'-hydroxythiophene-2-carboximidamide;thiophene-2-carbonitrile?
N'-hydroxythiophene-2-carboximidamide;thiophene-2-carbonitrile has a molecular weight of 251.34 g/mol, XLogP of 2.46, 1 rotatable bonds, 2 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for N'-hydroxythiophene-2-carboximidamide;thiophene-2-carbonitrile is sourced from PubChem (CID 172953513), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).