C18H28Cl4N4O5 — CID 159599607
4-(3,4-diaminophenyl)benzene-1,2-diamine;ethoxycarbonyl ethyl carbonate;tetrahydrochloride (PubChem CID 159599607) has the molecular formula C18H28Cl4N4O5 and a molecular weight of 522.26 g/mol. Its IUPAC name is 4-(3,4-diaminophenyl)benzene-1,2-diamine;ethoxycarbonyl ethyl carbonate;tetrahydrochloride.
| Compound Name | 4-(3,4-diaminophenyl)benzene-1,2-diamine;ethoxycarbonyl ethyl carbonate;tetrahydrochloride |
|---|---|
| PubChem CID | 159599607 |
| Molecular Formula | C18H28Cl4N4O5 |
| Molecular Weight | 522.26 g/mol |
| Exact Mass | 520.08 |
| IUPAC Name | 4-(3,4-diaminophenyl)benzene-1,2-diamine;ethoxycarbonyl ethyl carbonate;tetrahydrochloride |
| SMILES | CCOC(=O)OC(=O)OCC.Cl.Cl.Cl.Cl.Nc1ccc(-c2ccc(N)c(N)c2)cc1N |
| InChI | InChI=1S/C12H14N4.C6H10O5.4ClH/c13-9-3-1-7(5-11(9)15)8-2-4-10(14)12(16)6-8;1-3-9-5(7)11-6(8)10-4-2;;;;/h1-6H,13-16H2;3-4H2,1-2H3;4*1H |
| InChIKey | IZHVVDXAOHDFKU-UHFFFAOYSA-N |
| XLogP | 4.69 |
| TPSA | 165.91 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 522.26 |
| LogP ≤ 5 | 4.69 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'}, {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|