About N-[(Z)-4-[2-(diethylamino)ethylimino]pent-2-en-2-yl]-N',N'-diethylethane-1,2-diamine
N-[(Z)-4-[2-(diethylamino)ethylimino]pent-2-en-2-yl]-N',N'-diethylethane-1,2-diamine (PubChem CID 15960143) has the molecular formula C17H36N4
and a molecular weight of 296.50 g/mol. Its IUPAC name is N-[(Z)-4-[2-(diethylamino)ethylimino]pent-2-en-2-yl]-N',N'-diethylethane-1,2-diamine.
Molecular Properties
| Compound Name | N-[(Z)-4-[2-(diethylamino)ethylimino]pent-2-en-2-yl]-N',N'-diethylethane-1,2-diamine |
| PubChem CID | 15960143 |
| Molecular Formula | C17H36N4 |
| Molecular Weight | 296.50 g/mol |
| Exact Mass | 296.29 |
| IUPAC Name | N-[(Z)-4-[2-(diethylamino)ethylimino]pent-2-en-2-yl]-N',N'-diethylethane-1,2-diamine |
| SMILES | CCN(CC)CC/N=C(C)/C=C(/C)NCCN(CC)CC |
| InChI | InChI=1S/C17H36N4/c1-7-20(8-2)13-11-18-16(5)15-17(6)19-12-14-21(9-3)10-4/h15,18H,7-14H2,1-6H3/b16-15-,19-17+ |
| InChIKey | NDKNOCLMFZGXMD-IHBLQEGUSA-N |
| XLogP | 2.62 |
| TPSA | 30.87 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 21 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 296.50 |
| LogP ≤ 5 | 2.62 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|
Analyze N-[(Z)-4-[2-(diethylamino)ethylimino]pent-2-en-2-yl]-N',N'-diethylethane-1,2-diamine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of N-[(Z)-4-[2-(diethylamino)ethylimino]pent-2-en-2-yl]-N',N'-diethylethane-1,2-diamine?
The IUPAC name of N-[(Z)-4-[2-(diethylamino)ethylimino]pent-2-en-2-yl]-N',N'-diethylethane-1,2-diamine (CID 15960143) is N-[(Z)-4-[2-(diethylamino)ethylimino]pent-2-en-2-yl]-N',N'-diethylethane-1,2-diamine.
What is the SMILES notation for N-[(Z)-4-[2-(diethylamino)ethylimino]pent-2-en-2-yl]-N',N'-diethylethane-1,2-diamine?
The canonical SMILES for N-[(Z)-4-[2-(diethylamino)ethylimino]pent-2-en-2-yl]-N',N'-diethylethane-1,2-diamine is CCN(CC)CC/N=C(C)/C=C(/C)NCCN(CC)CC.
What is the InChIKey of N-[(Z)-4-[2-(diethylamino)ethylimino]pent-2-en-2-yl]-N',N'-diethylethane-1,2-diamine?
The InChIKey is NDKNOCLMFZGXMD-IHBLQEGUSA-N. The full InChI is InChI=1S/C17H36N4/c1-7-20(8-2)13-11-18-16(5)15-17(6)19-12-14-21(9-3)10-4/h15,18H,7-14H2,1-6H3/b16-15-,19-17+.
What are the key properties of N-[(Z)-4-[2-(diethylamino)ethylimino]pent-2-en-2-yl]-N',N'-diethylethane-1,2-diamine?
N-[(Z)-4-[2-(diethylamino)ethylimino]pent-2-en-2-yl]-N',N'-diethylethane-1,2-diamine has a molecular weight of 296.50 g/mol, XLogP of 2.62, 12 rotatable bonds, 1 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for N-[(Z)-4-[2-(diethylamino)ethylimino]pent-2-en-2-yl]-N',N'-diethylethane-1,2-diamine is sourced from PubChem (CID 15960143), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).