About 3-morpholin-4-ylpropan-1-ol;3-morpholin-4-ylpropyl methanesulfonate
3-morpholin-4-ylpropan-1-ol;3-morpholin-4-ylpropyl methanesulfonate (PubChem CID 159603618) has the molecular formula C15H32N2O6S
and a molecular weight of 368.50 g/mol. Its IUPAC name is 3-morpholin-4-ylpropan-1-ol;3-morpholin-4-ylpropyl methanesulfonate.
Molecular Properties
| Compound Name | 3-morpholin-4-ylpropan-1-ol;3-morpholin-4-ylpropyl methanesulfonate |
| PubChem CID | 159603618 |
| Molecular Formula | C15H32N2O6S |
| Molecular Weight | 368.50 g/mol |
| Exact Mass | 368.20 |
| IUPAC Name | 3-morpholin-4-ylpropan-1-ol;3-morpholin-4-ylpropyl methanesulfonate |
| SMILES | CS(=O)(=O)OCCCN1CCOCC1.OCCCN1CCOCC1 |
| InChI | InChI=1S/C8H17NO4S.C7H15NO2/c1-14(10,11)13-6-2-3-9-4-7-12-8-5-9;9-5-1-2-8-3-6-10-7-4-8/h2-8H2,1H3;9H,1-7H2 |
| InChIKey | MLUMNTBSGAXQLU-UHFFFAOYSA-N |
| XLogP | -0.61 |
| TPSA | 88.54 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 24 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 368.50 |
| LogP ≤ 5 | -0.61 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_1', 'substructure': 'N/A'} |
|---|
Analyze 3-morpholin-4-ylpropan-1-ol;3-morpholin-4-ylpropyl methanesulfonate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3-morpholin-4-ylpropan-1-ol;3-morpholin-4-ylpropyl methanesulfonate?
The IUPAC name of 3-morpholin-4-ylpropan-1-ol;3-morpholin-4-ylpropyl methanesulfonate (CID 159603618) is 3-morpholin-4-ylpropan-1-ol;3-morpholin-4-ylpropyl methanesulfonate.
What is the SMILES notation for 3-morpholin-4-ylpropan-1-ol;3-morpholin-4-ylpropyl methanesulfonate?
The canonical SMILES for 3-morpholin-4-ylpropan-1-ol;3-morpholin-4-ylpropyl methanesulfonate is CS(=O)(=O)OCCCN1CCOCC1.OCCCN1CCOCC1.
What is the InChIKey of 3-morpholin-4-ylpropan-1-ol;3-morpholin-4-ylpropyl methanesulfonate?
The InChIKey is MLUMNTBSGAXQLU-UHFFFAOYSA-N. The full InChI is InChI=1S/C8H17NO4S.C7H15NO2/c1-14(10,11)13-6-2-3-9-4-7-12-8-5-9;9-5-1-2-8-3-6-10-7-4-8/h2-8H2,1H3;9H,1-7H2.
What are the key properties of 3-morpholin-4-ylpropan-1-ol;3-morpholin-4-ylpropyl methanesulfonate?
3-morpholin-4-ylpropan-1-ol;3-morpholin-4-ylpropyl methanesulfonate has a molecular weight of 368.50 g/mol, XLogP of -0.61, 8 rotatable bonds, 1 hydrogen bond donors, and 8 hydrogen bond acceptors.
Where does this data come from?
All data for 3-morpholin-4-ylpropan-1-ol;3-morpholin-4-ylpropyl methanesulfonate is sourced from PubChem (CID 159603618), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).