About methanesulfonyl chloride;2-(2-morpholin-4-ylethoxy)ethanol;2-(2-morpholin-4-ylethoxy)ethyl methanesulfonate
methanesulfonyl chloride;2-(2-morpholin-4-ylethoxy)ethanol;2-(2-morpholin-4-ylethoxy)ethyl methanesulfonate (PubChem CID 161173837) has the molecular formula C18H39ClN2O10S2
and a molecular weight of 543.10 g/mol. Its IUPAC name is methanesulfonyl chloride;2-(2-morpholin-4-ylethoxy)ethanol;2-(2-morpholin-4-ylethoxy)ethyl methanesulfonate.
Molecular Properties
| Compound Name | methanesulfonyl chloride;2-(2-morpholin-4-ylethoxy)ethanol;2-(2-morpholin-4-ylethoxy)ethyl methanesulfonate |
| PubChem CID | 161173837 |
| Molecular Formula | C18H39ClN2O10S2 |
| Molecular Weight | 543.10 g/mol |
| Exact Mass | 542.17 |
| IUPAC Name | methanesulfonyl chloride;2-(2-morpholin-4-ylethoxy)ethanol;2-(2-morpholin-4-ylethoxy)ethyl methanesulfonate |
| SMILES | CS(=O)(=O)Cl.CS(=O)(=O)OCCOCCN1CCOCC1.OCCOCCN1CCOCC1 |
| InChI | InChI=1S/C9H19NO5S.C8H17NO3.CH3ClO2S/c1-16(11,12)15-9-8-14-7-4-10-2-5-13-6-3-10;10-4-8-12-7-3-9-1-5-11-6-2-9;1-5(2,3)4/h2-9H2,1H3;10H,1-8H2;1H3 |
| InChIKey | URNQZAAPAVPUDZ-UHFFFAOYSA-N |
| XLogP | -1.18 |
| TPSA | 141.14 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 12 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 33 |
| Complexity | — |
Lipinski Rule of Five
2 violations
| Rule | Value |
| MW ≤ 500 | 543.10 |
| LogP ≤ 5 | -1.18 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 12 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_1', 'substructure': 'N/A'} |
|---|
Analyze methanesulfonyl chloride;2-(2-morpholin-4-ylethoxy)ethanol;2-(2-morpholin-4-ylethoxy)ethyl methanesulfonate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of methanesulfonyl chloride;2-(2-morpholin-4-ylethoxy)ethanol;2-(2-morpholin-4-ylethoxy)ethyl methanesulfonate?
The IUPAC name of methanesulfonyl chloride;2-(2-morpholin-4-ylethoxy)ethanol;2-(2-morpholin-4-ylethoxy)ethyl methanesulfonate (CID 161173837) is methanesulfonyl chloride;2-(2-morpholin-4-ylethoxy)ethanol;2-(2-morpholin-4-ylethoxy)ethyl methanesulfonate.
What is the SMILES notation for methanesulfonyl chloride;2-(2-morpholin-4-ylethoxy)ethanol;2-(2-morpholin-4-ylethoxy)ethyl methanesulfonate?
The canonical SMILES for methanesulfonyl chloride;2-(2-morpholin-4-ylethoxy)ethanol;2-(2-morpholin-4-ylethoxy)ethyl methanesulfonate is CS(=O)(=O)Cl.CS(=O)(=O)OCCOCCN1CCOCC1.OCCOCCN1CCOCC1.
What is the InChIKey of methanesulfonyl chloride;2-(2-morpholin-4-ylethoxy)ethanol;2-(2-morpholin-4-ylethoxy)ethyl methanesulfonate?
The InChIKey is URNQZAAPAVPUDZ-UHFFFAOYSA-N. The full InChI is InChI=1S/C9H19NO5S.C8H17NO3.CH3ClO2S/c1-16(11,12)15-9-8-14-7-4-10-2-5-13-6-3-10;10-4-8-12-7-3-9-1-5-11-6-2-9;1-5(2,3)4/h2-9H2,1H3;10H,1-8H2;1H3.
What are the key properties of methanesulfonyl chloride;2-(2-morpholin-4-ylethoxy)ethanol;2-(2-morpholin-4-ylethoxy)ethyl methanesulfonate?
methanesulfonyl chloride;2-(2-morpholin-4-ylethoxy)ethanol;2-(2-morpholin-4-ylethoxy)ethyl methanesulfonate has a molecular weight of 543.10 g/mol, XLogP of -1.18, 12 rotatable bonds, 1 hydrogen bond donors, and 12 hydrogen bond acceptors.
Where does this data come from?
All data for methanesulfonyl chloride;2-(2-morpholin-4-ylethoxy)ethanol;2-(2-morpholin-4-ylethoxy)ethyl methanesulfonate is sourced from PubChem (CID 161173837), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).