C55H58F6N8O8 — CID 159604080
bis((2R)-N-[5-[2-[6-(4-aminophenyl)-3-pyridinyl]acetyl]-2-(trifluoromethoxy)phenyl]-2-morpholin-4-ylpropanamide);methane (PubChem CID 159604080) has the molecular formula C55H58F6N8O8 and a molecular weight of 1073.10 g/mol. Its IUPAC name is bis((2R)-N-[5-[2-[6-(4-aminophenyl)-3-pyridinyl]acetyl]-2-(trifluoromethoxy)phenyl]-2-morpholin-4-ylpropanamide);methane.
| Compound Name | bis((2R)-N-[5-[2-[6-(4-aminophenyl)-3-pyridinyl]acetyl]-2-(trifluoromethoxy)phenyl]-2-morpholin-4-ylpropanamide);methane |
|---|---|
| PubChem CID | 159604080 |
| Molecular Formula | C55H58F6N8O8 |
| Molecular Weight | 1073.10 g/mol |
| Exact Mass | 1072.43 |
| IUPAC Name | bis((2R)-N-[5-[2-[6-(4-aminophenyl)-3-pyridinyl]acetyl]-2-(trifluoromethoxy)phenyl]-2-morpholin-4-ylpropanamide);methane |
| SMILES | C.C[C@H](C(=O)Nc1cc(C(=O)Cc2ccc(-c3ccc(N)cc3)nc2)ccc1OC(F)(F)F)N1CCOCC1.C[C@H](C(=O)Nc1cc(C(=O)Cc2ccc(-c3ccc(N)cc3)nc2)ccc1OC(F)(F)F)N1CCOCC1 |
| InChI | InChI=1S/2C27H27F3N4O4.CH4/c2*1-17(34-10-12-37-13-11-34)26(36)33-23-15-20(5-9-25(23)38-27(28,29)30)24(35)14-18-2-8-22(32-16-18)19-3-6-21(31)7-4-19;/h2*2-9,15-17H,10-14,31H2,1H3,(H,33,36);1H4/t2*17-;/m11./s1 |
| InChIKey | MLVVMDWDQVGABV-NCTGSHGJSA-N |
| XLogP | 9.26 |
| TPSA | 213.56 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 14 |
| Rotatable Bonds | 16 |
| Heavy Atoms | 77 |
| Complexity | — |
3 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 1073.10 |
| LogP ≤ 5 | 9.26 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 14 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|