C20H20N4 — CID 159604907
4-(1-piperidin-4-ylpyrazol-4-yl)-9H-indeno[2,1-b]pyridine (PubChem CID 159604907) has the molecular formula C20H20N4 and a molecular weight of 316.41 g/mol. Its IUPAC name is 4-(1-piperidin-4-ylpyrazol-4-yl)-9H-indeno[2,1-b]pyridine.
| Compound Name | 4-(1-piperidin-4-ylpyrazol-4-yl)-9H-indeno[2,1-b]pyridine |
|---|---|
| PubChem CID | 159604907 |
| Molecular Formula | C20H20N4 |
| Molecular Weight | 316.41 g/mol |
| Exact Mass | 316.17 |
| IUPAC Name | 4-(1-piperidin-4-ylpyrazol-4-yl)-9H-indeno[2,1-b]pyridine |
| SMILES | c1ccc2c(c1)Cc1nccc(-c3cnn(C4CCNCC4)c3)c1-2 |
| InChI | InChI=1S/C20H20N4/c1-2-4-17-14(3-1)11-19-20(17)18(7-10-22-19)15-12-23-24(13-15)16-5-8-21-9-6-16/h1-4,7,10,12-13,16,21H,5-6,8-9,11H2 |
| InChIKey | QRBCXECYJMBVGW-UHFFFAOYSA-N |
| XLogP | 3.44 |
| TPSA | 42.74 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 316.41 |
| LogP ≤ 5 | 3.44 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |