C13H16N2O5 — CID 159607407
2-hydroxyacetic acid;2-N-prop-2-enylbenzene-1,2-dicarboxamide (PubChem CID 159607407) has the molecular formula C13H16N2O5 and a molecular weight of 280.28 g/mol. Its IUPAC name is 2-hydroxyacetic acid;2-N-prop-2-enylbenzene-1,2-dicarboxamide.
| Compound Name | 2-hydroxyacetic acid;2-N-prop-2-enylbenzene-1,2-dicarboxamide |
|---|---|
| PubChem CID | 159607407 |
| Molecular Formula | C13H16N2O5 |
| Molecular Weight | 280.28 g/mol |
| Exact Mass | 280.11 |
| IUPAC Name | 2-hydroxyacetic acid;2-N-prop-2-enylbenzene-1,2-dicarboxamide |
| SMILES | C=CCNC(=O)c1ccccc1C(N)=O.O=C(O)CO |
| InChI | InChI=1S/C11H12N2O2.C2H4O3/c1-2-7-13-11(15)9-6-4-3-5-8(9)10(12)14;3-1-2(4)5/h2-6H,1,7H2,(H2,12,14)(H,13,15);3H,1H2,(H,4,5) |
| InChIKey | MMGHGWGBGKXWBQ-UHFFFAOYSA-N |
| XLogP | -0.24 |
| TPSA | 129.72 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 280.28 |
| LogP ≤ 5 | -0.24 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|