C9H10N2O2S — CID 21410227
2-N-(sulfanylmethyl)benzene-1,2-dicarboxamide (PubChem CID 21410227) has the molecular formula C9H10N2O2S and a molecular weight of 210.26 g/mol. Its IUPAC name is 2-N-(sulfanylmethyl)benzene-1,2-dicarboxamide.
| Compound Name | 2-N-(sulfanylmethyl)benzene-1,2-dicarboxamide |
|---|---|
| PubChem CID | 21410227 |
| Molecular Formula | C9H10N2O2S |
| Molecular Weight | 210.26 g/mol |
| Exact Mass | 210.05 |
| IUPAC Name | 2-N-(sulfanylmethyl)benzene-1,2-dicarboxamide |
| SMILES | NC(=O)c1ccccc1C(=O)NCS |
| InChI | InChI=1S/C9H10N2O2S/c10-8(12)6-3-1-2-4-7(6)9(13)11-5-14/h1-4,14H,5H2,(H2,10,12)(H,11,13) |
| InChIKey | YRZJIOACVUWHSL-UHFFFAOYSA-N |
| XLogP | 0.40 |
| TPSA | 72.19 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 210.26 |
| LogP ≤ 5 | 0.40 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'thiol_2', 'substructure': 'N/A'} |
|---|