C6H13NO4S — CID 159607588
1-methoxy-3-methyl-1-oxo-2-(sulfinoamino)butane (PubChem CID 159607588) has the molecular formula C6H13NO4S and a molecular weight of 195.24 g/mol. Its IUPAC name is 1-methoxy-3-methyl-1-oxo-2-(sulfinoamino)butane.
| Compound Name | 1-methoxy-3-methyl-1-oxo-2-(sulfinoamino)butane |
|---|---|
| PubChem CID | 159607588 |
| Molecular Formula | C6H13NO4S |
| Molecular Weight | 195.24 g/mol |
| Exact Mass | 195.06 |
| IUPAC Name | 1-methoxy-3-methyl-1-oxo-2-(sulfinoamino)butane |
| SMILES | COC(=O)C(NS(=O)O)C(C)C |
| InChI | InChI=1S/C6H13NO4S/c1-4(2)5(6(8)11-3)7-12(9)10/h4-5,7H,1-3H3,(H,9,10) |
| InChIKey | PQTKMSIPGHJEPL-UHFFFAOYSA-N |
| XLogP | -0.09 |
| TPSA | 75.63 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 12 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 195.24 |
| LogP ≤ 5 | -0.09 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'sulfinic_acid', 'substructure': 'N/A'} |
|---|