About 4-O-(2-hydroxyethyl) 1-O-pentyl 2-methylidenebutanedioate
4-O-(2-hydroxyethyl) 1-O-pentyl 2-methylidenebutanedioate (PubChem CID 159609621) has the molecular formula C12H20O5
and a molecular weight of 244.29 g/mol. Its IUPAC name is 4-O-(2-hydroxyethyl) 1-O-pentyl 2-methylidenebutanedioate.
Molecular Properties
| Compound Name | 4-O-(2-hydroxyethyl) 1-O-pentyl 2-methylidenebutanedioate |
| PubChem CID | 159609621 |
| Molecular Formula | C12H20O5 |
| Molecular Weight | 244.29 g/mol |
| Exact Mass | 244.13 |
| IUPAC Name | 4-O-(2-hydroxyethyl) 1-O-pentyl 2-methylidenebutanedioate |
| SMILES | C=C(CC(=O)OCCO)C(=O)OCCCCC |
| InChI | InChI=1S/C12H20O5/c1-3-4-5-7-17-12(15)10(2)9-11(14)16-8-6-13/h13H,2-9H2,1H3 |
| InChIKey | NIAHKISDIDJZMF-UHFFFAOYSA-N |
| XLogP | 1.20 |
| TPSA | 72.83 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 17 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 244.29 |
| LogP ≤ 5 | 1.20 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|
Analyze 4-O-(2-hydroxyethyl) 1-O-pentyl 2-methylidenebutanedioate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 4-O-(2-hydroxyethyl) 1-O-pentyl 2-methylidenebutanedioate?
The IUPAC name of 4-O-(2-hydroxyethyl) 1-O-pentyl 2-methylidenebutanedioate (CID 159609621) is 4-O-(2-hydroxyethyl) 1-O-pentyl 2-methylidenebutanedioate.
What is the SMILES notation for 4-O-(2-hydroxyethyl) 1-O-pentyl 2-methylidenebutanedioate?
The canonical SMILES for 4-O-(2-hydroxyethyl) 1-O-pentyl 2-methylidenebutanedioate is C=C(CC(=O)OCCO)C(=O)OCCCCC.
What is the InChIKey of 4-O-(2-hydroxyethyl) 1-O-pentyl 2-methylidenebutanedioate?
The InChIKey is NIAHKISDIDJZMF-UHFFFAOYSA-N. The full InChI is InChI=1S/C12H20O5/c1-3-4-5-7-17-12(15)10(2)9-11(14)16-8-6-13/h13H,2-9H2,1H3.
What are the key properties of 4-O-(2-hydroxyethyl) 1-O-pentyl 2-methylidenebutanedioate?
4-O-(2-hydroxyethyl) 1-O-pentyl 2-methylidenebutanedioate has a molecular weight of 244.29 g/mol, XLogP of 1.20, 9 rotatable bonds, 1 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for 4-O-(2-hydroxyethyl) 1-O-pentyl 2-methylidenebutanedioate is sourced from PubChem (CID 159609621), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).