C20H15ClFeO2 — CID 159612935
6-chloro-2-cyclopenta-2,4-dien-1-ylidene-7-methylchromen-4-olate;cyclopenta-1,3-diene;iron(2+) (PubChem CID 159612935) has the molecular formula C20H15ClFeO2 and a molecular weight of 378.64 g/mol. Its IUPAC name is 6-chloro-2-cyclopenta-2,4-dien-1-ylidene-7-methylchromen-4-olate;cyclopenta-1,3-diene;iron(2+).
| Compound Name | 6-chloro-2-cyclopenta-2,4-dien-1-ylidene-7-methylchromen-4-olate;cyclopenta-1,3-diene;iron(2+) |
|---|---|
| PubChem CID | 159612935 |
| Molecular Formula | C20H15ClFeO2 |
| Molecular Weight | 378.64 g/mol |
| Exact Mass | 378.01 |
| IUPAC Name | 6-chloro-2-cyclopenta-2,4-dien-1-ylidene-7-methylchromen-4-olate;cyclopenta-1,3-diene;iron(2+) |
| SMILES | Cc1cc2c(cc1Cl)C([O-])=CC(=C1C=CC=C1)O2.[Fe+2].c1cc[cH-]c1 |
| InChI | InChI=1S/C15H11ClO2.C5H5.Fe/c1-9-6-15-11(7-12(9)16)13(17)8-14(18-15)10-4-2-3-5-10;1-2-4-5-3-1;/h2-8,17H,1H3;1-5H;/q;-1;+2/p-1 |
| InChIKey | OKPXVRNGDSPJQH-UHFFFAOYSA-M |
| XLogP | 4.53 |
| TPSA | 32.29 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 378.64 |
| LogP ≤ 5 | 4.53 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|