C18H23ClN4OS — CID 159613402
6-(3-amino-2-chlorophenyl)sulfanyl-3-(4-ethyl-4-methylpiperidin-1-yl)-1H-pyrazin-2-one (PubChem CID 159613402) has the molecular formula C18H23ClN4OS and a molecular weight of 378.93 g/mol. Its IUPAC name is 6-(3-amino-2-chlorophenyl)sulfanyl-3-(4-ethyl-4-methylpiperidin-1-yl)-1H-pyrazin-2-one.
| Compound Name | 6-(3-amino-2-chlorophenyl)sulfanyl-3-(4-ethyl-4-methylpiperidin-1-yl)-1H-pyrazin-2-one |
|---|---|
| PubChem CID | 159613402 |
| Molecular Formula | C18H23ClN4OS |
| Molecular Weight | 378.93 g/mol |
| Exact Mass | 378.13 |
| IUPAC Name | 6-(3-amino-2-chlorophenyl)sulfanyl-3-(4-ethyl-4-methylpiperidin-1-yl)-1H-pyrazin-2-one |
| SMILES | CCC1(C)CCN(c2ncc(Sc3cccc(N)c3Cl)[nH]c2=O)CC1 |
| InChI | InChI=1S/C18H23ClN4OS/c1-3-18(2)7-9-23(10-8-18)16-17(24)22-14(11-21-16)25-13-6-4-5-12(20)15(13)19/h4-6,11H,3,7-10,20H2,1-2H3,(H,22,24) |
| InChIKey | FKKMHUJTSTYAIE-UHFFFAOYSA-N |
| XLogP | 4.17 |
| TPSA | 75.01 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 378.93 |
| LogP ≤ 5 | 4.17 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|