C19H23ClN4OS — CID 156711754
6-(2-amino-3-chlorophenyl)sulfanyl-3-(8-azaspiro[4.5]decan-8-yl)-1H-pyrazin-2-one (PubChem CID 156711754) has the molecular formula C19H23ClN4OS and a molecular weight of 390.94 g/mol. Its IUPAC name is 6-(2-amino-3-chlorophenyl)sulfanyl-3-(8-azaspiro[4.5]decan-8-yl)-1H-pyrazin-2-one.
| Compound Name | 6-(2-amino-3-chlorophenyl)sulfanyl-3-(8-azaspiro[4.5]decan-8-yl)-1H-pyrazin-2-one |
|---|---|
| PubChem CID | 156711754 |
| Molecular Formula | C19H23ClN4OS |
| Molecular Weight | 390.94 g/mol |
| Exact Mass | 390.13 |
| IUPAC Name | 6-(2-amino-3-chlorophenyl)sulfanyl-3-(8-azaspiro[4.5]decan-8-yl)-1H-pyrazin-2-one |
| SMILES | Nc1c(Cl)cccc1Sc1cnc(N2CCC3(CCCC3)CC2)c(=O)[nH]1 |
| InChI | InChI=1S/C19H23ClN4OS/c20-13-4-3-5-14(16(13)21)26-15-12-22-17(18(25)23-15)24-10-8-19(9-11-24)6-1-2-7-19/h3-5,12H,1-2,6-11,21H2,(H,23,25) |
| InChIKey | JBIVFTISPVBQFO-UHFFFAOYSA-N |
| XLogP | 4.32 |
| TPSA | 75.01 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 390.94 |
| LogP ≤ 5 | 4.32 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|