C23H37ClN6S2 — CID 144887467
3-(3-amino-2-chlorophenyl)sulfanyl-6-(8-azaspiro[4.5]decan-8-yl)pyrazin-2-amine;2-methylpropane;thiohydroxylamine (PubChem CID 144887467) has the molecular formula C23H37ClN6S2 and a molecular weight of 497.18 g/mol. Its IUPAC name is 3-(3-amino-2-chlorophenyl)sulfanyl-6-(8-azaspiro[4.5]decan-8-yl)pyrazin-2-amine;2-methylpropane;thiohydroxylamine.
| Compound Name | 3-(3-amino-2-chlorophenyl)sulfanyl-6-(8-azaspiro[4.5]decan-8-yl)pyrazin-2-amine;2-methylpropane;thiohydroxylamine |
|---|---|
| PubChem CID | 144887467 |
| Molecular Formula | C23H37ClN6S2 |
| Molecular Weight | 497.18 g/mol |
| Exact Mass | 496.22 |
| IUPAC Name | 3-(3-amino-2-chlorophenyl)sulfanyl-6-(8-azaspiro[4.5]decan-8-yl)pyrazin-2-amine;2-methylpropane;thiohydroxylamine |
| SMILES | CC(C)C.NS.Nc1cccc(Sc2ncc(N3CCC4(CCCC4)CC3)nc2N)c1Cl |
| InChI | InChI=1S/C19H24ClN5S.C4H10.H3NS/c20-16-13(21)4-3-5-14(16)26-18-17(22)24-15(12-23-18)25-10-8-19(9-11-25)6-1-2-7-19;1-4(2)3;1-2/h3-5,12H,1-2,6-11,21H2,(H2,22,24);4H,1-3H3;2H,1H2 |
| InChIKey | CNJJXULFXSJYNI-UHFFFAOYSA-N |
| XLogP | 6.06 |
| TPSA | 107.08 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 497.18 |
| LogP ≤ 5 | 6.06 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'}, {'alert_name': 'thiol_2', 'substructure': 'N/A'} |
|---|