C19H28N6S — CID 178154439
3-(3-amino-2-ethylphenyl)sulfanyl-6-[4-methyl-4-(methylamino)piperidin-1-yl]pyrazin-2-amine (PubChem CID 178154439) has the molecular formula C19H28N6S and a molecular weight of 372.54 g/mol. Its IUPAC name is 3-(3-amino-2-ethylphenyl)sulfanyl-6-[4-methyl-4-(methylamino)piperidin-1-yl]pyrazin-2-amine.
| Compound Name | 3-(3-amino-2-ethylphenyl)sulfanyl-6-[4-methyl-4-(methylamino)piperidin-1-yl]pyrazin-2-amine |
|---|---|
| PubChem CID | 178154439 |
| Molecular Formula | C19H28N6S |
| Molecular Weight | 372.54 g/mol |
| Exact Mass | 372.21 |
| IUPAC Name | 3-(3-amino-2-ethylphenyl)sulfanyl-6-[4-methyl-4-(methylamino)piperidin-1-yl]pyrazin-2-amine |
| SMILES | CCc1c(N)cccc1Sc1ncc(N2CCC(C)(NC)CC2)nc1N |
| InChI | InChI=1S/C19H28N6S/c1-4-13-14(20)6-5-7-15(13)26-18-17(21)24-16(12-23-18)25-10-8-19(2,22-3)9-11-25/h5-7,12,22H,4,8-11,20H2,1-3H3,(H2,21,24) |
| InChIKey | UJXLTNSWFUAEHI-UHFFFAOYSA-N |
| XLogP | 2.93 |
| TPSA | 93.09 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 372.54 |
| LogP ≤ 5 | 2.93 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|