About 6-(4,4-dimethylpiperidin-1-yl)-3-phenylsulfanylpyrazin-2-amine
6-(4,4-dimethylpiperidin-1-yl)-3-phenylsulfanylpyrazin-2-amine (PubChem CID 167263224) has the molecular formula C17H22N4S
and a molecular weight of 314.46 g/mol. Its IUPAC name is 6-(4,4-dimethylpiperidin-1-yl)-3-phenylsulfanylpyrazin-2-amine.
Molecular Properties
| Compound Name | 6-(4,4-dimethylpiperidin-1-yl)-3-phenylsulfanylpyrazin-2-amine |
| PubChem CID | 167263224 |
| Molecular Formula | C17H22N4S |
| Molecular Weight | 314.46 g/mol |
| Exact Mass | 314.16 |
| IUPAC Name | 6-(4,4-dimethylpiperidin-1-yl)-3-phenylsulfanylpyrazin-2-amine |
| SMILES | CC1(C)CCN(c2cnc(Sc3ccccc3)c(N)n2)CC1 |
| InChI | InChI=1S/C17H22N4S/c1-17(2)8-10-21(11-9-17)14-12-19-16(15(18)20-14)22-13-6-4-3-5-7-13/h3-7,12H,8-11H2,1-2H3,(H2,18,20) |
| InChIKey | TVMWKZINBLMLFK-UHFFFAOYSA-N |
| XLogP | 3.84 |
| TPSA | 55.04 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 22 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 314.46 |
| LogP ≤ 5 | 3.84 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
Analyze 6-(4,4-dimethylpiperidin-1-yl)-3-phenylsulfanylpyrazin-2-amine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 6-(4,4-dimethylpiperidin-1-yl)-3-phenylsulfanylpyrazin-2-amine?
The IUPAC name of 6-(4,4-dimethylpiperidin-1-yl)-3-phenylsulfanylpyrazin-2-amine (CID 167263224) is 6-(4,4-dimethylpiperidin-1-yl)-3-phenylsulfanylpyrazin-2-amine.
What is the SMILES notation for 6-(4,4-dimethylpiperidin-1-yl)-3-phenylsulfanylpyrazin-2-amine?
The canonical SMILES for 6-(4,4-dimethylpiperidin-1-yl)-3-phenylsulfanylpyrazin-2-amine is CC1(C)CCN(c2cnc(Sc3ccccc3)c(N)n2)CC1.
What is the InChIKey of 6-(4,4-dimethylpiperidin-1-yl)-3-phenylsulfanylpyrazin-2-amine?
The InChIKey is TVMWKZINBLMLFK-UHFFFAOYSA-N. The full InChI is InChI=1S/C17H22N4S/c1-17(2)8-10-21(11-9-17)14-12-19-16(15(18)20-14)22-13-6-4-3-5-7-13/h3-7,12H,8-11H2,1-2H3,(H2,18,20).
What are the key properties of 6-(4,4-dimethylpiperidin-1-yl)-3-phenylsulfanylpyrazin-2-amine?
6-(4,4-dimethylpiperidin-1-yl)-3-phenylsulfanylpyrazin-2-amine has a molecular weight of 314.46 g/mol, XLogP of 3.84, 3 rotatable bonds, 1 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for 6-(4,4-dimethylpiperidin-1-yl)-3-phenylsulfanylpyrazin-2-amine is sourced from PubChem (CID 167263224), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).