C33H41ClN8O2S — CID 166112401
3-[4-[4-[[[1-[6-amino-5-(3-amino-2-chlorophenyl)sulfanylpyrazin-2-yl]-4-methylpiperidin-4-yl]amino]methyl]piperidin-1-yl]phenyl]piperidine-2,6-dione (PubChem CID 166112401) has the molecular formula C33H41ClN8O2S and a molecular weight of 649.27 g/mol. Its IUPAC name is 3-[4-[4-[[[1-[6-amino-5-(3-amino-2-chlorophenyl)sulfanylpyrazin-2-yl]-4-methylpiperidin-4-yl]amino]methyl]piperidin-1-yl]phenyl]piperidine-2,6-dione.
| Compound Name | 3-[4-[4-[[[1-[6-amino-5-(3-amino-2-chlorophenyl)sulfanylpyrazin-2-yl]-4-methylpiperidin-4-yl]amino]methyl]piperidin-1-yl]phenyl]piperidine-2,6-dione |
|---|---|
| PubChem CID | 166112401 |
| Molecular Formula | C33H41ClN8O2S |
| Molecular Weight | 649.27 g/mol |
| Exact Mass | 648.28 |
| IUPAC Name | 3-[4-[4-[[[1-[6-amino-5-(3-amino-2-chlorophenyl)sulfanylpyrazin-2-yl]-4-methylpiperidin-4-yl]amino]methyl]piperidin-1-yl]phenyl]piperidine-2,6-dione |
| SMILES | CC1(NCC2CCN(c3ccc(C4CCC(=O)NC4=O)cc3)CC2)CCN(c2cnc(Sc3cccc(N)c3Cl)c(N)n2)CC1 |
| InChI | InChI=1S/C33H41ClN8O2S/c1-33(13-17-42(18-14-33)27-20-37-32(30(36)39-27)45-26-4-2-3-25(35)29(26)34)38-19-21-11-15-41(16-12-21)23-7-5-22(6-8-23)24-9-10-28(43)40-31(24)44/h2-8,20-21,24,38H,9-19,35H2,1H3,(H2,36,39)(H,40,43,44) |
| InChIKey | XWADEAOLKSCYOQ-UHFFFAOYSA-N |
| XLogP | 4.83 |
| TPSA | 142.50 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 45 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 649.27 |
| LogP ≤ 5 | 4.83 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'anil_di_alk_E(186)', 'substructure': 'N/A'}, {'alert_name': 'aniline', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|