C22H30ClN5O2S — CID 161362762
tert-butyl 2-[1-[6-amino-5-(3-amino-2-chlorophenyl)sulfanylpyrazin-2-yl]-4-methylpiperidin-4-yl]acetate (PubChem CID 161362762) has the molecular formula C22H30ClN5O2S and a molecular weight of 464.04 g/mol. Its IUPAC name is tert-butyl 2-[1-[6-amino-5-(3-amino-2-chlorophenyl)sulfanylpyrazin-2-yl]-4-methylpiperidin-4-yl]acetate.
| Compound Name | tert-butyl 2-[1-[6-amino-5-(3-amino-2-chlorophenyl)sulfanylpyrazin-2-yl]-4-methylpiperidin-4-yl]acetate |
|---|---|
| PubChem CID | 161362762 |
| Molecular Formula | C22H30ClN5O2S |
| Molecular Weight | 464.04 g/mol |
| Exact Mass | 463.18 |
| IUPAC Name | tert-butyl 2-[1-[6-amino-5-(3-amino-2-chlorophenyl)sulfanylpyrazin-2-yl]-4-methylpiperidin-4-yl]acetate |
| SMILES | CC1(CC(=O)OC(C)(C)C)CCN(c2cnc(Sc3cccc(N)c3Cl)c(N)n2)CC1 |
| InChI | InChI=1S/C22H30ClN5O2S/c1-21(2,3)30-17(29)12-22(4)8-10-28(11-9-22)16-13-26-20(19(25)27-16)31-15-7-5-6-14(24)18(15)23/h5-7,13H,8-12,24H2,1-4H3,(H2,25,27) |
| InChIKey | RMVWYRWVFURMEZ-UHFFFAOYSA-N |
| XLogP | 4.78 |
| TPSA | 107.36 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 464.04 |
| LogP ≤ 5 | 4.78 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|