C18H25ClN6S2 — CID 144887421
6-(8-azaspiro[4.5]decan-8-yl)-3-[(3-chloro-4-pyridinyl)sulfanyl]pyrazin-2-amine;thiohydroxylamine (PubChem CID 144887421) has the molecular formula C18H25ClN6S2 and a molecular weight of 425.03 g/mol. Its IUPAC name is 6-(8-azaspiro[4.5]decan-8-yl)-3-[(3-chloro-4-pyridinyl)sulfanyl]pyrazin-2-amine;thiohydroxylamine.
| Compound Name | 6-(8-azaspiro[4.5]decan-8-yl)-3-[(3-chloro-4-pyridinyl)sulfanyl]pyrazin-2-amine;thiohydroxylamine |
|---|---|
| PubChem CID | 144887421 |
| Molecular Formula | C18H25ClN6S2 |
| Molecular Weight | 425.03 g/mol |
| Exact Mass | 424.13 |
| IUPAC Name | 6-(8-azaspiro[4.5]decan-8-yl)-3-[(3-chloro-4-pyridinyl)sulfanyl]pyrazin-2-amine;thiohydroxylamine |
| SMILES | NS.Nc1nc(N2CCC3(CCCC3)CC2)cnc1Sc1ccncc1Cl |
| InChI | InChI=1S/C18H22ClN5S.H3NS/c19-13-11-21-8-3-14(13)25-17-16(20)23-15(12-22-17)24-9-6-18(7-10-24)4-1-2-5-18;1-2/h3,8,11-12H,1-2,4-7,9-10H2,(H2,20,23);2H,1H2 |
| InChIKey | IXSQODZUXYVZKG-UHFFFAOYSA-N |
| XLogP | 4.21 |
| TPSA | 93.95 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 425.03 |
| LogP ≤ 5 | 4.21 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'thiol_2', 'substructure': 'N/A'} |
|---|