C19H23ClFN5S — CID 135225757
3-[(5-chloro-2-fluoro-4-pyridinyl)sulfanyl]-6-[(4R)-4-methyl-8-azaspiro[4.5]decan-8-yl]pyrazin-2-amine (PubChem CID 135225757) has the molecular formula C19H23ClFN5S and a molecular weight of 407.95 g/mol. Its IUPAC name is 3-[(5-chloro-2-fluoro-4-pyridinyl)sulfanyl]-6-[(4R)-4-methyl-8-azaspiro[4.5]decan-8-yl]pyrazin-2-amine.
| Compound Name | 3-[(5-chloro-2-fluoro-4-pyridinyl)sulfanyl]-6-[(4R)-4-methyl-8-azaspiro[4.5]decan-8-yl]pyrazin-2-amine |
|---|---|
| PubChem CID | 135225757 |
| Molecular Formula | C19H23ClFN5S |
| Molecular Weight | 407.95 g/mol |
| Exact Mass | 407.13 |
| IUPAC Name | 3-[(5-chloro-2-fluoro-4-pyridinyl)sulfanyl]-6-[(4R)-4-methyl-8-azaspiro[4.5]decan-8-yl]pyrazin-2-amine |
| SMILES | C[C@@H]1CCCC12CCN(c1cnc(Sc3cc(F)ncc3Cl)c(N)n1)CC2 |
| InChI | InChI=1S/C19H23ClFN5S/c1-12-3-2-4-19(12)5-7-26(8-6-19)16-11-24-18(17(22)25-16)27-14-9-15(21)23-10-13(14)20/h9-12H,2-8H2,1H3,(H2,22,25)/t12-/m1/s1 |
| InChIKey | XYYBZSHEGJLDFD-GFCCVEGCSA-N |
| XLogP | 4.80 |
| TPSA | 67.93 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 407.95 |
| LogP ≤ 5 | 4.80 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'} |
|---|