C22H26N6O6S — CID 159613667
3-(4-cyclopropylsulfonyl-6-nitropyrazolo[5,4-b]pyridin-1-yl)-1-(1-methylpyrazol-3-yl)-4-(oxan-4-yl)butan-2-one (PubChem CID 159613667) has the molecular formula C22H26N6O6S and a molecular weight of 502.55 g/mol. Its IUPAC name is 3-(4-cyclopropylsulfonyl-6-nitropyrazolo[5,4-b]pyridin-1-yl)-1-(1-methylpyrazol-3-yl)-4-(oxan-4-yl)butan-2-one.
| Compound Name | 3-(4-cyclopropylsulfonyl-6-nitropyrazolo[5,4-b]pyridin-1-yl)-1-(1-methylpyrazol-3-yl)-4-(oxan-4-yl)butan-2-one |
|---|---|
| PubChem CID | 159613667 |
| Molecular Formula | C22H26N6O6S |
| Molecular Weight | 502.55 g/mol |
| Exact Mass | 502.16 |
| IUPAC Name | 3-(4-cyclopropylsulfonyl-6-nitropyrazolo[5,4-b]pyridin-1-yl)-1-(1-methylpyrazol-3-yl)-4-(oxan-4-yl)butan-2-one |
| SMILES | Cn1ccc(CC(=O)C(CC2CCOCC2)n2ncc3c(S(=O)(=O)C4CC4)cc([N+](=O)[O-])nc32)n1 |
| InChI | InChI=1S/C22H26N6O6S/c1-26-7-4-15(25-26)11-19(29)18(10-14-5-8-34-9-6-14)27-22-17(13-23-27)20(12-21(24-22)28(30)31)35(32,33)16-2-3-16/h4,7,12-14,16,18H,2-3,5-6,8-11H2,1H3 |
| InChIKey | VDFGKYUIFZVANX-UHFFFAOYSA-N |
| XLogP | 2.18 |
| TPSA | 152.11 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 11 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 35 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 502.55 |
| LogP ≤ 5 | 2.18 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 11 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|