C20H24F2N2O6S — CID 70660422
methyl 2-[4-cyclopropylsulfonyl-6-(difluoromethoxy)indazol-1-yl]-3-(oxan-4-yl)propanoate (PubChem CID 70660422) has the molecular formula C20H24F2N2O6S and a molecular weight of 458.48 g/mol. Its IUPAC name is methyl 2-[4-cyclopropylsulfonyl-6-(difluoromethoxy)indazol-1-yl]-3-(oxan-4-yl)propanoate.
| Compound Name | methyl 2-[4-cyclopropylsulfonyl-6-(difluoromethoxy)indazol-1-yl]-3-(oxan-4-yl)propanoate |
|---|---|
| PubChem CID | 70660422 |
| Molecular Formula | C20H24F2N2O6S |
| Molecular Weight | 458.48 g/mol |
| Exact Mass | 458.13 |
| IUPAC Name | methyl 2-[4-cyclopropylsulfonyl-6-(difluoromethoxy)indazol-1-yl]-3-(oxan-4-yl)propanoate |
| SMILES | COC(=O)C(CC1CCOCC1)n1ncc2c(S(=O)(=O)C3CC3)cc(OC(F)F)cc21 |
| InChI | InChI=1S/C20H24F2N2O6S/c1-28-19(25)17(8-12-4-6-29-7-5-12)24-16-9-13(30-20(21)22)10-18(15(16)11-23-24)31(26,27)14-2-3-14/h9-12,14,17,20H,2-8H2,1H3 |
| InChIKey | VYSKUSTYYRZPJP-UHFFFAOYSA-N |
| XLogP | 3.10 |
| TPSA | 96.72 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 458.48 |
| LogP ≤ 5 | 3.10 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 8 |