C50H38F2N8O4 — CID 159615679
2-[4-[8-(1,3-benzodioxol-5-yl)-7-fluoroimidazo[4,5-c]quinolin-1-yl]phenyl]ethanamine (PubChem CID 159615679) has the molecular formula C50H38F2N8O4 and a molecular weight of 852.90 g/mol. Its IUPAC name is 2-[4-[8-(1,3-benzodioxol-5-yl)-7-fluoroimidazo[4,5-c]quinolin-1-yl]phenyl]ethanamine.
| Compound Name | 2-[4-[8-(1,3-benzodioxol-5-yl)-7-fluoroimidazo[4,5-c]quinolin-1-yl]phenyl]ethanamine |
|---|---|
| PubChem CID | 159615679 |
| Molecular Formula | C50H38F2N8O4 |
| Molecular Weight | 852.90 g/mol |
| Exact Mass | 852.30 |
| IUPAC Name | 2-[4-[8-(1,3-benzodioxol-5-yl)-7-fluoroimidazo[4,5-c]quinolin-1-yl]phenyl]ethanamine |
| SMILES | NCCc1ccc(-n2cnc3cnc4cc(F)c(-c5ccc6c(c5)OCO6)cc4c32)cc1.NCCc1ccc(-n2cnc3cnc4cc(F)c(-c5ccc6c(c5)OCO6)cc4c32)cc1 |
| InChI | InChI=1S/2C25H19FN4O2/c2*26-20-11-21-19(10-18(20)16-3-6-23-24(9-16)32-14-31-23)25-22(12-28-21)29-13-30(25)17-4-1-15(2-5-17)7-8-27/h2*1-6,9-13H,7-8,14,27H2 |
| InChIKey | MNGFMGJGFFMLDE-UHFFFAOYSA-N |
| XLogP | 9.22 |
| TPSA | 150.38 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 12 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 64 |
| Complexity | — |
3 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 852.90 |
| LogP ≤ 5 | 9.22 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 12 |