C19H31N3O2 — CID 159616588
(4S)-4-[1-(cyclohexanecarbonyl)piperidin-3-yl]-6-imino-1,4-dimethylpiperidin-2-one (PubChem CID 159616588) has the molecular formula C19H31N3O2 and a molecular weight of 333.48 g/mol. Its IUPAC name is (4S)-4-[1-(cyclohexanecarbonyl)piperidin-3-yl]-6-imino-1,4-dimethylpiperidin-2-one.
| Compound Name | (4S)-4-[1-(cyclohexanecarbonyl)piperidin-3-yl]-6-imino-1,4-dimethylpiperidin-2-one |
|---|---|
| PubChem CID | 159616588 |
| Molecular Formula | C19H31N3O2 |
| Molecular Weight | 333.48 g/mol |
| Exact Mass | 333.24 |
| IUPAC Name | (4S)-4-[1-(cyclohexanecarbonyl)piperidin-3-yl]-6-imino-1,4-dimethylpiperidin-2-one |
| SMILES | [H]/N=C1\C[C@](C)(C2CCCN(C(=O)C3CCCCC3)C2)CC(=O)N1C |
| InChI | InChI=1S/C19H31N3O2/c1-19(11-16(20)21(2)17(23)12-19)15-9-6-10-22(13-15)18(24)14-7-4-3-5-8-14/h14-15,20H,3-13H2,1-2H3/b20-16+/t15?,19-/m0/s1 |
| InChIKey | MNJBEAZFLWRUSB-IHGLSCQVSA-N |
| XLogP | 3.04 |
| TPSA | 64.47 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 333.48 |
| LogP ≤ 5 | 3.04 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|