C20H21F3N4O2 — CID 159619875
(7S)-4,7,8-trimethyl-2-[[3-(2,3,4-trifluorophenoxy)cyclobutyl]methyl]-5,7-dihydropteridin-6-one (PubChem CID 159619875) has the molecular formula C20H21F3N4O2 and a molecular weight of 406.41 g/mol. Its IUPAC name is (7S)-4,7,8-trimethyl-2-[[3-(2,3,4-trifluorophenoxy)cyclobutyl]methyl]-5,7-dihydropteridin-6-one.
| Compound Name | (7S)-4,7,8-trimethyl-2-[[3-(2,3,4-trifluorophenoxy)cyclobutyl]methyl]-5,7-dihydropteridin-6-one |
|---|---|
| PubChem CID | 159619875 |
| Molecular Formula | C20H21F3N4O2 |
| Molecular Weight | 406.41 g/mol |
| Exact Mass | 406.16 |
| IUPAC Name | (7S)-4,7,8-trimethyl-2-[[3-(2,3,4-trifluorophenoxy)cyclobutyl]methyl]-5,7-dihydropteridin-6-one |
| SMILES | Cc1nc(CC2CC(Oc3ccc(F)c(F)c3F)C2)nc2c1NC(=O)[C@H](C)N2C |
| InChI | InChI=1S/C20H21F3N4O2/c1-9-18-19(27(3)10(2)20(28)26-18)25-15(24-9)8-11-6-12(7-11)29-14-5-4-13(21)16(22)17(14)23/h4-5,10-12H,6-8H2,1-3H3,(H,26,28)/t10-,11?,12?/m0/s1 |
| InChIKey | MNTJDQDTWIWUHZ-UNXYVOJBSA-N |
| XLogP | 3.38 |
| TPSA | 67.35 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 406.41 |
| LogP ≤ 5 | 3.38 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'halogenated_ring_2', 'substructure': 'N/A'} |
|---|