C20H22F3N7O2 — CID 146194667
1-(2,3,4-trifluorophenyl)-3-[3-[[(7S)-4,7,8-trimethyl-6-oxo-5,7-dihydropteridin-2-yl]amino]cyclobutyl]urea (PubChem CID 146194667) has the molecular formula C20H22F3N7O2 and a molecular weight of 449.44 g/mol. Its IUPAC name is 1-(2,3,4-trifluorophenyl)-3-[3-[[(7S)-4,7,8-trimethyl-6-oxo-5,7-dihydropteridin-2-yl]amino]cyclobutyl]urea.
| Compound Name | 1-(2,3,4-trifluorophenyl)-3-[3-[[(7S)-4,7,8-trimethyl-6-oxo-5,7-dihydropteridin-2-yl]amino]cyclobutyl]urea |
|---|---|
| PubChem CID | 146194667 |
| Molecular Formula | C20H22F3N7O2 |
| Molecular Weight | 449.44 g/mol |
| Exact Mass | 449.18 |
| IUPAC Name | 1-(2,3,4-trifluorophenyl)-3-[3-[[(7S)-4,7,8-trimethyl-6-oxo-5,7-dihydropteridin-2-yl]amino]cyclobutyl]urea |
| SMILES | Cc1nc(NC2CC(NC(=O)Nc3ccc(F)c(F)c3F)C2)nc2c1NC(=O)[C@H](C)N2C |
| InChI | InChI=1S/C20H22F3N7O2/c1-8-16-17(30(3)9(2)18(31)28-16)29-19(24-8)25-10-6-11(7-10)26-20(32)27-13-5-4-12(21)14(22)15(13)23/h4-5,9-11H,6-7H2,1-3H3,(H,28,31)(H,24,25,29)(H2,26,27,32)/t9-,10?,11?/m0/s1 |
| InChIKey | PNXKKLFFKOQAPN-WHXUTIOJSA-N |
| XLogP | 2.74 |
| TPSA | 111.28 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 449.44 |
| LogP ≤ 5 | 2.74 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'halogenated_ring_2', 'substructure': 'N/A'} |
|---|