C19H20O5S — CID 159623550
[4-methyl-3-[(8-oxo-6,7-dihydro-5H-naphthalen-2-yl)oxymethyl]phenyl] methanesulfonate (PubChem CID 159623550) has the molecular formula C19H20O5S and a molecular weight of 360.43 g/mol. Its IUPAC name is [4-methyl-3-[(8-oxo-6,7-dihydro-5H-naphthalen-2-yl)oxymethyl]phenyl] methanesulfonate.
| Compound Name | [4-methyl-3-[(8-oxo-6,7-dihydro-5H-naphthalen-2-yl)oxymethyl]phenyl] methanesulfonate |
|---|---|
| PubChem CID | 159623550 |
| Molecular Formula | C19H20O5S |
| Molecular Weight | 360.43 g/mol |
| Exact Mass | 360.10 |
| IUPAC Name | [4-methyl-3-[(8-oxo-6,7-dihydro-5H-naphthalen-2-yl)oxymethyl]phenyl] methanesulfonate |
| SMILES | Cc1ccc(OS(C)(=O)=O)cc1COc1ccc2c(c1)C(=O)CCC2 |
| InChI | InChI=1S/C19H20O5S/c1-13-6-8-17(24-25(2,21)22)10-15(13)12-23-16-9-7-14-4-3-5-19(20)18(14)11-16/h6-11H,3-5,12H2,1-2H3 |
| InChIKey | NSBQQGZYYQMGHV-UHFFFAOYSA-N |
| XLogP | 3.43 |
| TPSA | 69.67 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 360.43 |
| LogP ≤ 5 | 3.43 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Sulfonic_acid_1', 'substructure': 'N/A'} |
|---|