About ethyl prop-2-ynoate;5-phenyl-1H-pyrazole
ethyl prop-2-ynoate;5-phenyl-1H-pyrazole (PubChem CID 159627857) has the molecular formula C14H14N2O2
and a molecular weight of 242.28 g/mol. Its IUPAC name is ethyl prop-2-ynoate;5-phenyl-1H-pyrazole.
Molecular Properties
| Compound Name | ethyl prop-2-ynoate;5-phenyl-1H-pyrazole |
| PubChem CID | 159627857 |
| Molecular Formula | C14H14N2O2 |
| Molecular Weight | 242.28 g/mol |
| Exact Mass | 242.11 |
| IUPAC Name | ethyl prop-2-ynoate;5-phenyl-1H-pyrazole |
| SMILES | C#CC(=O)OCC.c1ccc(-c2ccn[nH]2)cc1 |
| InChI | InChI=1S/C9H8N2.C5H6O2/c1-2-4-8(5-3-1)9-6-7-10-11-9;1-3-5(6)7-4-2/h1-7H,(H,10,11);1H,4H2,2H3 |
| InChIKey | MOSRSXNCOFMIOZ-UHFFFAOYSA-N |
| XLogP | 2.26 |
| TPSA | 54.98 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 18 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 242.28 |
| LogP ≤ 5 | 2.26 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Michael_acceptor_5', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|
Analyze ethyl prop-2-ynoate;5-phenyl-1H-pyrazole with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of ethyl prop-2-ynoate;5-phenyl-1H-pyrazole?
The IUPAC name of ethyl prop-2-ynoate;5-phenyl-1H-pyrazole (CID 159627857) is ethyl prop-2-ynoate;5-phenyl-1H-pyrazole.
What is the SMILES notation for ethyl prop-2-ynoate;5-phenyl-1H-pyrazole?
The canonical SMILES for ethyl prop-2-ynoate;5-phenyl-1H-pyrazole is C#CC(=O)OCC.c1ccc(-c2ccn[nH]2)cc1.
What is the InChIKey of ethyl prop-2-ynoate;5-phenyl-1H-pyrazole?
The InChIKey is MOSRSXNCOFMIOZ-UHFFFAOYSA-N. The full InChI is InChI=1S/C9H8N2.C5H6O2/c1-2-4-8(5-3-1)9-6-7-10-11-9;1-3-5(6)7-4-2/h1-7H,(H,10,11);1H,4H2,2H3.
What are the key properties of ethyl prop-2-ynoate;5-phenyl-1H-pyrazole?
ethyl prop-2-ynoate;5-phenyl-1H-pyrazole has a molecular weight of 242.28 g/mol, XLogP of 2.26, 2 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for ethyl prop-2-ynoate;5-phenyl-1H-pyrazole is sourced from PubChem (CID 159627857), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).