About ethyl prop-2-ynoate;propanoic acid
ethyl prop-2-ynoate;propanoic acid (PubChem CID 175189820) has the molecular formula C8H12O4
and a molecular weight of 172.18 g/mol. Its IUPAC name is ethyl prop-2-ynoate;propanoic acid.
Molecular Properties
| Compound Name | ethyl prop-2-ynoate;propanoic acid |
| PubChem CID | 175189820 |
| Molecular Formula | C8H12O4 |
| Molecular Weight | 172.18 g/mol |
| Exact Mass | 172.07 |
| IUPAC Name | ethyl prop-2-ynoate;propanoic acid |
| SMILES | C#CC(=O)OCC.CCC(=O)O |
| InChI | InChI=1S/C5H6O2.C3H6O2/c1-3-5(6)7-4-2;1-2-3(4)5/h1H,4H2,2H3;2H2,1H3,(H,4,5) |
| InChIKey | FOVUYSQQMIPROQ-UHFFFAOYSA-N |
| XLogP | 0.66 |
| TPSA | 63.60 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 12 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 172.18 |
| LogP ≤ 5 | 0.66 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Michael_acceptor_5', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|
Analyze ethyl prop-2-ynoate;propanoic acid with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of ethyl prop-2-ynoate;propanoic acid?
The IUPAC name of ethyl prop-2-ynoate;propanoic acid (CID 175189820) is ethyl prop-2-ynoate;propanoic acid.
What is the SMILES notation for ethyl prop-2-ynoate;propanoic acid?
The canonical SMILES for ethyl prop-2-ynoate;propanoic acid is C#CC(=O)OCC.CCC(=O)O.
What is the InChIKey of ethyl prop-2-ynoate;propanoic acid?
The InChIKey is FOVUYSQQMIPROQ-UHFFFAOYSA-N. The full InChI is InChI=1S/C5H6O2.C3H6O2/c1-3-5(6)7-4-2;1-2-3(4)5/h1H,4H2,2H3;2H2,1H3,(H,4,5).
What are the key properties of ethyl prop-2-ynoate;propanoic acid?
ethyl prop-2-ynoate;propanoic acid has a molecular weight of 172.18 g/mol, XLogP of 0.66, 2 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for ethyl prop-2-ynoate;propanoic acid is sourced from PubChem (CID 175189820), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).