About ethyl prop-2-ynoate
ethyl prop-2-ynoate (PubChem CID 12182) has the molecular formula C5H6O2
and a molecular weight of 98.10 g/mol. Its IUPAC name is ethyl prop-2-ynoate.
Molecular Properties
| Compound Name | ethyl prop-2-ynoate |
| PubChem CID | 12182 |
| Molecular Formula | C5H6O2 |
| Molecular Weight | 98.10 g/mol |
| Exact Mass | 98.04 |
| IUPAC Name | ethyl prop-2-ynoate |
| SMILES | C#CC(=O)OCC |
| InChI | InChI=1S/C5H6O2/c1-3-5(6)7-4-2/h1H,4H2,2H3 |
| InChIKey | FMVJYQGSRWVMQV-UHFFFAOYSA-N |
| XLogP | 0.18 |
| TPSA | 26.30 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 7 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 98.10 |
| LogP ≤ 5 | 0.18 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Michael_acceptor_5', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|
Analyze ethyl prop-2-ynoate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of ethyl prop-2-ynoate?
The IUPAC name of ethyl prop-2-ynoate (CID 12182) is ethyl prop-2-ynoate.
What is the SMILES notation for ethyl prop-2-ynoate?
The canonical SMILES for ethyl prop-2-ynoate is C#CC(=O)OCC.
What is the InChIKey of ethyl prop-2-ynoate?
The InChIKey is FMVJYQGSRWVMQV-UHFFFAOYSA-N. The full InChI is InChI=1S/C5H6O2/c1-3-5(6)7-4-2/h1H,4H2,2H3.
What are the key properties of ethyl prop-2-ynoate?
ethyl prop-2-ynoate has a molecular weight of 98.10 g/mol, XLogP of 0.18, 1 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for ethyl prop-2-ynoate is sourced from PubChem (CID 12182), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).