C20H16BrFN4O2 — CID 159629556
(9Z)-16-bromo-15-fluoro-12-oxa-3,6,20,25-tetrazatetracyclo[19.3.1.02,6.013,18]pentacosa-1(25),2,4,9,13,15,17,21,23-nonaen-19-one (PubChem CID 159629556) has the molecular formula C20H16BrFN4O2 and a molecular weight of 443.28 g/mol. Its IUPAC name is (9Z)-16-bromo-15-fluoro-12-oxa-3,6,20,25-tetrazatetracyclo[19.3.1.02,6.013,18]pentacosa-1(25),2,4,9,13,15,17,21,23-nonaen-19-one.
| Compound Name | (9Z)-16-bromo-15-fluoro-12-oxa-3,6,20,25-tetrazatetracyclo[19.3.1.02,6.013,18]pentacosa-1(25),2,4,9,13,15,17,21,23-nonaen-19-one |
|---|---|
| PubChem CID | 159629556 |
| Molecular Formula | C20H16BrFN4O2 |
| Molecular Weight | 443.28 g/mol |
| Exact Mass | 442.04 |
| IUPAC Name | (9Z)-16-bromo-15-fluoro-12-oxa-3,6,20,25-tetrazatetracyclo[19.3.1.02,6.013,18]pentacosa-1(25),2,4,9,13,15,17,21,23-nonaen-19-one |
| SMILES | O=C1Nc2cccc(n2)-c2nccn2CC/C=C\COc2cc(F)c(Br)cc21 |
| InChI | InChI=1S/C20H16BrFN4O2/c21-14-11-13-17(12-15(14)22)28-10-3-1-2-8-26-9-7-23-19(26)16-5-4-6-18(24-16)25-20(13)27/h1,3-7,9,11-12H,2,8,10H2,(H,24,25,27)/b3-1- |
| InChIKey | RRSHXHMMRXRDIJ-IWQZZHSRSA-N |
| XLogP | 4.44 |
| TPSA | 69.04 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 443.28 |
| LogP ≤ 5 | 4.44 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|