C16H20BBrF2N4O2 — CID 159629941
5-bromo-6-fluoropyridin-2-amine;6-fluoro-5-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)pyridin-2-amine (PubChem CID 159629941) has the molecular formula C16H20BBrF2N4O2 and a molecular weight of 429.07 g/mol. Its IUPAC name is 5-bromo-6-fluoropyridin-2-amine;6-fluoro-5-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)pyridin-2-amine.
| Compound Name | 5-bromo-6-fluoropyridin-2-amine;6-fluoro-5-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)pyridin-2-amine |
|---|---|
| PubChem CID | 159629941 |
| Molecular Formula | C16H20BBrF2N4O2 |
| Molecular Weight | 429.07 g/mol |
| Exact Mass | 428.08 |
| IUPAC Name | 5-bromo-6-fluoropyridin-2-amine;6-fluoro-5-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)pyridin-2-amine |
| SMILES | CC1(C)OB(c2ccc(N)nc2F)OC1(C)C.Nc1ccc(Br)c(F)n1 |
| InChI | InChI=1S/C11H16BFN2O2.C5H4BrFN2/c1-10(2)11(3,4)17-12(16-10)7-5-6-8(14)15-9(7)13;6-3-1-2-4(8)9-5(3)7/h5-6H,1-4H3,(H2,14,15);1-2H,(H2,8,9) |
| InChIKey | MOZIZPHYVQAMLM-UHFFFAOYSA-N |
| XLogP | 2.67 |
| TPSA | 96.28 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 429.07 |
| LogP ≤ 5 | 2.67 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|