C18H20BBrF6N4O2 — CID 161426652
5-bromo-4-(trifluoromethyl)pyridin-2-amine;5-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)-4-(trifluoromethyl)pyridin-2-amine (PubChem CID 161426652) has the molecular formula C18H20BBrF6N4O2 and a molecular weight of 529.09 g/mol. Its IUPAC name is 5-bromo-4-(trifluoromethyl)pyridin-2-amine;5-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)-4-(trifluoromethyl)pyridin-2-amine.
| Compound Name | 5-bromo-4-(trifluoromethyl)pyridin-2-amine;5-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)-4-(trifluoromethyl)pyridin-2-amine |
|---|---|
| PubChem CID | 161426652 |
| Molecular Formula | C18H20BBrF6N4O2 |
| Molecular Weight | 529.09 g/mol |
| Exact Mass | 528.08 |
| IUPAC Name | 5-bromo-4-(trifluoromethyl)pyridin-2-amine;5-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)-4-(trifluoromethyl)pyridin-2-amine |
| SMILES | CC1(C)OB(c2cnc(N)cc2C(F)(F)F)OC1(C)C.Nc1cc(C(F)(F)F)c(Br)cn1 |
| InChI | InChI=1S/C12H16BF3N2O2.C6H4BrF3N2/c1-10(2)11(3,4)20-13(19-10)8-6-18-9(17)5-7(8)12(14,15)16;7-4-2-12-5(11)1-3(4)6(8,9)10/h5-6H,1-4H3,(H2,17,18);1-2H,(H2,11,12) |
| InChIKey | VXLFTJNEJIUSBB-UHFFFAOYSA-N |
| XLogP | 4.43 |
| TPSA | 96.28 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 529.09 |
| LogP ≤ 5 | 4.43 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|