C52H30N6S — CID 159631248
5-(4-dibenzothiophen-2-yl-6-phenyl-1,3,5-triazin-2-yl)-2-[5-(2,3,4,5,6-pentadeuteriophenyl)indolo[3,2-c]carbazol-12-yl]benzonitrile (PubChem CID 159631248) has the molecular formula C52H30N6S and a molecular weight of 775.95 g/mol. Its IUPAC name is 5-(4-dibenzothiophen-2-yl-6-phenyl-1,3,5-triazin-2-yl)-2-[5-(2,3,4,5,6-pentadeuteriophenyl)indolo[3,2-c]carbazol-12-yl]benzonitrile.
| Compound Name | 5-(4-dibenzothiophen-2-yl-6-phenyl-1,3,5-triazin-2-yl)-2-[5-(2,3,4,5,6-pentadeuteriophenyl)indolo[3,2-c]carbazol-12-yl]benzonitrile |
|---|---|
| PubChem CID | 159631248 |
| Molecular Formula | C52H30N6S |
| Molecular Weight | 775.95 g/mol |
| Exact Mass | 775.26 |
| IUPAC Name | 5-(4-dibenzothiophen-2-yl-6-phenyl-1,3,5-triazin-2-yl)-2-[5-(2,3,4,5,6-pentadeuteriophenyl)indolo[3,2-c]carbazol-12-yl]benzonitrile |
| SMILES | [2H]c1c([2H])c([2H])c(-n2c3ccccc3c3c2ccc2c4ccccc4n(-c4ccc(-c5nc(-c6ccccc6)nc(-c6ccc7sc8ccccc8c7c6)n5)cc4C#N)c23)c([2H])c1[2H] |
| InChI | InChI=1S/C52H30N6S/c53-31-35-29-33(51-54-50(32-13-3-1-4-14-32)55-52(56-51)34-24-28-47-41(30-34)38-18-9-12-22-46(38)59-47)23-26-42(35)58-43-20-10-7-17-37(43)39-25-27-45-48(49(39)58)40-19-8-11-21-44(40)57(45)36-15-5-2-6-16-36/h1-30H/i2D,5D,6D,15D,16D |
| InChIKey | LNTCSNCVCPCJJI-KLZHWEBPSA-N |
| XLogP | 13.31 |
| TPSA | 72.32 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 59 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 775.95 |
| LogP ≤ 5 | 13.31 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |