About 1-methyl-4-(5-methylnonan-5-yl)benzene;5-methylnonan-5-ol
1-methyl-4-(5-methylnonan-5-yl)benzene;5-methylnonan-5-ol (PubChem CID 159636901) has the molecular formula C27H50O
and a molecular weight of 390.70 g/mol. Its IUPAC name is 1-methyl-4-(5-methylnonan-5-yl)benzene;5-methylnonan-5-ol.
Molecular Properties
| Compound Name | 1-methyl-4-(5-methylnonan-5-yl)benzene;5-methylnonan-5-ol |
| PubChem CID | 159636901 |
| Molecular Formula | C27H50O |
| Molecular Weight | 390.70 g/mol |
| Exact Mass | 390.39 |
| IUPAC Name | 1-methyl-4-(5-methylnonan-5-yl)benzene;5-methylnonan-5-ol |
| SMILES | CCCCC(C)(CCCC)c1ccc(C)cc1.CCCCC(C)(O)CCCC |
| InChI | InChI=1S/C17H28.C10H22O/c1-5-7-13-17(4,14-8-6-2)16-11-9-15(3)10-12-16;1-4-6-8-10(3,11)9-7-5-2/h9-12H,5-8,13-14H2,1-4H3;11H,4-9H2,1-3H3 |
| InChIKey | MPVZASFHBOKVQY-UHFFFAOYSA-N |
| XLogP | 8.75 |
| TPSA | 20.23 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 28 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 390.70 |
| LogP ≤ 5 | 8.75 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
Analyze 1-methyl-4-(5-methylnonan-5-yl)benzene;5-methylnonan-5-ol with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1-methyl-4-(5-methylnonan-5-yl)benzene;5-methylnonan-5-ol?
The IUPAC name of 1-methyl-4-(5-methylnonan-5-yl)benzene;5-methylnonan-5-ol (CID 159636901) is 1-methyl-4-(5-methylnonan-5-yl)benzene;5-methylnonan-5-ol.
What is the SMILES notation for 1-methyl-4-(5-methylnonan-5-yl)benzene;5-methylnonan-5-ol?
The canonical SMILES for 1-methyl-4-(5-methylnonan-5-yl)benzene;5-methylnonan-5-ol is CCCCC(C)(CCCC)c1ccc(C)cc1.CCCCC(C)(O)CCCC.
What is the InChIKey of 1-methyl-4-(5-methylnonan-5-yl)benzene;5-methylnonan-5-ol?
The InChIKey is MPVZASFHBOKVQY-UHFFFAOYSA-N. The full InChI is InChI=1S/C17H28.C10H22O/c1-5-7-13-17(4,14-8-6-2)16-11-9-15(3)10-12-16;1-4-6-8-10(3,11)9-7-5-2/h9-12H,5-8,13-14H2,1-4H3;11H,4-9H2,1-3H3.
What are the key properties of 1-methyl-4-(5-methylnonan-5-yl)benzene;5-methylnonan-5-ol?
1-methyl-4-(5-methylnonan-5-yl)benzene;5-methylnonan-5-ol has a molecular weight of 390.70 g/mol, XLogP of 8.75, 13 rotatable bonds, 1 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for 1-methyl-4-(5-methylnonan-5-yl)benzene;5-methylnonan-5-ol is sourced from PubChem (CID 159636901), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).