About 1-(4,7-dimethyloctan-4-yl)-4-methylbenzene
1-(4,7-dimethyloctan-4-yl)-4-methylbenzene (PubChem CID 142145973) has the molecular formula C17H28
and a molecular weight of 232.41 g/mol. Its IUPAC name is 1-(4,7-dimethyloctan-4-yl)-4-methylbenzene.
Molecular Properties
| Compound Name | 1-(4,7-dimethyloctan-4-yl)-4-methylbenzene |
| PubChem CID | 142145973 |
| Molecular Formula | C17H28 |
| Molecular Weight | 232.41 g/mol |
| Exact Mass | 232.22 |
| IUPAC Name | 1-(4,7-dimethyloctan-4-yl)-4-methylbenzene |
| SMILES | CCCC(C)(CCC(C)C)c1ccc(C)cc1 |
| InChI | InChI=1S/C17H28/c1-6-12-17(5,13-11-14(2)3)16-9-7-15(4)8-10-16/h7-10,14H,6,11-13H2,1-5H3 |
| InChIKey | LJLWFQSDGXCWTG-UHFFFAOYSA-N |
| XLogP | 5.49 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 6 |
| Heavy Atoms | 17 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 232.41 |
| LogP ≤ 5 | 5.49 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
Analyze 1-(4,7-dimethyloctan-4-yl)-4-methylbenzene with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1-(4,7-dimethyloctan-4-yl)-4-methylbenzene?
The IUPAC name of 1-(4,7-dimethyloctan-4-yl)-4-methylbenzene (CID 142145973) is 1-(4,7-dimethyloctan-4-yl)-4-methylbenzene.
What is the SMILES notation for 1-(4,7-dimethyloctan-4-yl)-4-methylbenzene?
The canonical SMILES for 1-(4,7-dimethyloctan-4-yl)-4-methylbenzene is CCCC(C)(CCC(C)C)c1ccc(C)cc1.
What is the InChIKey of 1-(4,7-dimethyloctan-4-yl)-4-methylbenzene?
The InChIKey is LJLWFQSDGXCWTG-UHFFFAOYSA-N. The full InChI is InChI=1S/C17H28/c1-6-12-17(5,13-11-14(2)3)16-9-7-15(4)8-10-16/h7-10,14H,6,11-13H2,1-5H3.
What are the key properties of 1-(4,7-dimethyloctan-4-yl)-4-methylbenzene?
1-(4,7-dimethyloctan-4-yl)-4-methylbenzene has a molecular weight of 232.41 g/mol, XLogP of 5.49, 6 rotatable bonds, 0 hydrogen bond donors, and 0 hydrogen bond acceptors.
Where does this data come from?
All data for 1-(4,7-dimethyloctan-4-yl)-4-methylbenzene is sourced from PubChem (CID 142145973), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).