About 2-(2-chloroethyl)-4-methoxybenzoyl chloride;4-methoxy-2-methylbenzoic acid
2-(2-chloroethyl)-4-methoxybenzoyl chloride;4-methoxy-2-methylbenzoic acid (PubChem CID 159639357) has the molecular formula C19H20Cl2O5
and a molecular weight of 399.27 g/mol. Its IUPAC name is 2-(2-chloroethyl)-4-methoxybenzoyl chloride;4-methoxy-2-methylbenzoic acid.
Molecular Properties
| Compound Name | 2-(2-chloroethyl)-4-methoxybenzoyl chloride;4-methoxy-2-methylbenzoic acid |
| PubChem CID | 159639357 |
| Molecular Formula | C19H20Cl2O5 |
| Molecular Weight | 399.27 g/mol |
| Exact Mass | 398.07 |
| IUPAC Name | 2-(2-chloroethyl)-4-methoxybenzoyl chloride;4-methoxy-2-methylbenzoic acid |
| SMILES | COc1ccc(C(=O)Cl)c(CCCl)c1.COc1ccc(C(=O)O)c(C)c1 |
| InChI | InChI=1S/C10H10Cl2O2.C9H10O3/c1-14-8-2-3-9(10(12)13)7(6-8)4-5-11;1-6-5-7(12-2)3-4-8(6)9(10)11/h2-3,6H,4-5H2,1H3;3-5H,1-2H3,(H,10,11) |
| InChIKey | MQDOQEKFHPMAHX-UHFFFAOYSA-N |
| XLogP | 4.56 |
| TPSA | 72.83 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 26 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 399.27 |
| LogP ≤ 5 | 4.56 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'acid_halide', 'substructure': 'N/A'}, {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|
Analyze 2-(2-chloroethyl)-4-methoxybenzoyl chloride;4-methoxy-2-methylbenzoic acid with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-(2-chloroethyl)-4-methoxybenzoyl chloride;4-methoxy-2-methylbenzoic acid?
The IUPAC name of 2-(2-chloroethyl)-4-methoxybenzoyl chloride;4-methoxy-2-methylbenzoic acid (CID 159639357) is 2-(2-chloroethyl)-4-methoxybenzoyl chloride;4-methoxy-2-methylbenzoic acid.
What is the SMILES notation for 2-(2-chloroethyl)-4-methoxybenzoyl chloride;4-methoxy-2-methylbenzoic acid?
The canonical SMILES for 2-(2-chloroethyl)-4-methoxybenzoyl chloride;4-methoxy-2-methylbenzoic acid is COc1ccc(C(=O)Cl)c(CCCl)c1.COc1ccc(C(=O)O)c(C)c1.
What is the InChIKey of 2-(2-chloroethyl)-4-methoxybenzoyl chloride;4-methoxy-2-methylbenzoic acid?
The InChIKey is MQDOQEKFHPMAHX-UHFFFAOYSA-N. The full InChI is InChI=1S/C10H10Cl2O2.C9H10O3/c1-14-8-2-3-9(10(12)13)7(6-8)4-5-11;1-6-5-7(12-2)3-4-8(6)9(10)11/h2-3,6H,4-5H2,1H3;3-5H,1-2H3,(H,10,11).
What are the key properties of 2-(2-chloroethyl)-4-methoxybenzoyl chloride;4-methoxy-2-methylbenzoic acid?
2-(2-chloroethyl)-4-methoxybenzoyl chloride;4-methoxy-2-methylbenzoic acid has a molecular weight of 399.27 g/mol, XLogP of 4.56, 6 rotatable bonds, 1 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 2-(2-chloroethyl)-4-methoxybenzoyl chloride;4-methoxy-2-methylbenzoic acid is sourced from PubChem (CID 159639357), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).